The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(((5S,6S,9S)-5-(4-fluorophenyl)-9-(2-(trifluoromethyl)phenyl)-1,7-dioxa-4-azaspiro[5.5]undecan-4-yl)methyl)-1H-1,2,3-triazol-5-yl)-N,N-dimethylmethanamine ID: ALA5284869
Max Phase: Preclinical
Molecular Formula: C27H31F4N5O2
Molecular Weight: 533.57
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)Cc1[nH]nnc1CN1CCO[C@@]2(CC[C@@H](c3ccccc3C(F)(F)F)CO2)[C@@H]1c1ccc(F)cc1
Standard InChI: InChI=1S/C27H31F4N5O2/c1-35(2)15-23-24(33-34-32-23)16-36-13-14-37-26(25(36)18-7-9-20(28)10-8-18)12-11-19(17-38-26)21-5-3-4-6-22(21)27(29,30)31/h3-10,19,25H,11-17H2,1-2H3,(H,32,33,34)/t19-,25+,26-/m1/s1
Standard InChI Key: RHLFRQYCXXEYMH-JSRBVGTNSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
2.9574 -2.3917 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.2429 -1.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5328 -2.3911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8162 -1.9829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8162 -1.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5309 -0.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2429 -1.1539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1018 -0.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6128 -1.1545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3276 -0.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3276 0.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6128 0.4960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1018 0.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8162 -0.3290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5308 0.0833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5308 0.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2455 1.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9628 0.9066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6745 1.3230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6745 2.1440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9582 2.5566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2455 2.1460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5310 2.5586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8165 2.9710 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.5310 3.3836 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.8165 2.1460 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.8162 1.3209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1018 0.9084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6128 -1.9795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3274 -2.3921 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4135 -3.2121 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2202 -3.3836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6325 -2.6695 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0807 -2.0566 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2942 -1.2597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0911 -1.0462 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3047 -0.2492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6745 -1.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
2 7 2 0
7 6 1 0
8 5 1 6
9 8 1 0
10 9 1 0
11 10 1 0
11 12 1 0
8 13 1 0
13 12 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 6
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
22 23 1 0
23 24 1 0
23 25 1 0
23 26 1 0
16 27 1 0
27 28 1 0
13 28 1 6
9 29 1 0
29 30 1 0
31 30 1 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 2 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 533.57Molecular Weight (Monoisotopic): 533.2414AlogP: 4.89#Rotatable Bonds: 6Polar Surface Area: 66.51Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.14CX Basic pKa: 6.87CX LogP: 4.73CX LogD: 4.81Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.46Np Likeness Score: -0.58
References 1. Wu YJ, Meanwell NA.. (2021) Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design., 64 (14.0): [PMID:34213340 ] [10.1021/acs.jmedchem.1c00790 ]