1-(4-(((5S,6S,9S)-5-(4-fluorophenyl)-9-(2-(trifluoromethyl)phenyl)-1,7-dioxa-4-azaspiro[5.5]undecan-4-yl)methyl)-1H-1,2,3-triazol-5-yl)-N,N-dimethylmethanamine

ID: ALA5284869

Max Phase: Preclinical

Molecular Formula: C27H31F4N5O2

Molecular Weight: 533.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)Cc1[nH]nnc1CN1CCO[C@@]2(CC[C@@H](c3ccccc3C(F)(F)F)CO2)[C@@H]1c1ccc(F)cc1

Standard InChI:  InChI=1S/C27H31F4N5O2/c1-35(2)15-23-24(33-34-32-23)16-36-13-14-37-26(25(36)18-7-9-20(28)10-8-18)12-11-19(17-38-26)21-5-3-4-6-22(21)27(29,30)31/h3-10,19,25H,11-17H2,1-2H3,(H,32,33,34)/t19-,25+,26-/m1/s1

Standard InChI Key:  RHLFRQYCXXEYMH-JSRBVGTNSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    2.9574   -2.3917    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2429   -1.9792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5328   -2.3911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8162   -1.9829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8162   -1.1543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5309   -0.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2429   -1.1539    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018   -0.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6128   -1.1545    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3276   -0.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3276    0.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6128    0.4960    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018    0.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8162   -0.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5308    0.0833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5308    0.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2455    1.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9628    0.9066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6745    1.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6745    2.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9582    2.5566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2455    2.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5310    2.5586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8165    2.9710    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5310    3.3836    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8165    2.1460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8162    1.3209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018    0.9084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6128   -1.9795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3274   -2.3921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4135   -3.2121    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2202   -3.3836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6325   -2.6695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0807   -2.0566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2942   -1.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0911   -1.0462    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3047   -0.2492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6745   -1.6296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  2  7  2  0
  7  6  1  0
  8  5  1  6
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11 12  1  0
  8 13  1  0
 13 12  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  6
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 17  2  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 16 27  1  0
 27 28  1  0
 13 28  1  6
  9 29  1  0
 29 30  1  0
 31 30  1  0
 31 32  2  0
 32 33  1  0
 33 34  1  0
 34 30  2  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284869

    ---

Associated Targets(Human)

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 533.57Molecular Weight (Monoisotopic): 533.2414AlogP: 4.89#Rotatable Bonds: 6
Polar Surface Area: 66.51Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.14CX Basic pKa: 6.87CX LogP: 4.73CX LogD: 4.81
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.46Np Likeness Score: -0.58

References

1. Wu YJ, Meanwell NA..  (2021)  Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design.,  64  (14.0): [PMID:34213340] [10.1021/acs.jmedchem.1c00790]

Source