The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(((3S,4S)-3-(3,5-difluorophenyl)-4-((4-(2-methyl-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazol-3-yl)piperidin-1-yl)methyl)pyrrolidin-1-yl)methyl)cyclopentanecarboxylic acid ID: ALA5284872
Max Phase: Preclinical
Molecular Formula: C30H40F2N4O2
Molecular Weight: 526.67
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn2c(c1C1CCN(C[C@H]3CN(CC4(C(=O)O)CCCC4)C[C@@H]3c3cc(F)cc(F)c3)CC1)CCC2
Standard InChI: InChI=1S/C30H40F2N4O2/c1-20-28(27-5-4-10-36(27)33-20)21-6-11-34(12-7-21)16-23-17-35(19-30(29(37)38)8-2-3-9-30)18-26(23)22-13-24(31)15-25(32)14-22/h13-15,21,23,26H,2-12,16-19H2,1H3,(H,37,38)/t23-,26+/m0/s1
Standard InChI Key: TVSDIXMZHFZVGK-JYFHCDHNSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-1.5215 -0.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1890 -0.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9340 0.5918 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1090 0.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8540 -0.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0569 -0.4065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5265 0.1769 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3129 0.9740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8964 1.5576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6935 1.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9071 0.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3235 -0.0365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2770 1.9275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1480 2.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8829 3.1166 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4661 2.5334 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0916 1.7984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4333 3.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3467 1.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1719 1.3064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5845 0.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4097 0.5918 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1719 -0.1228 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9921 1.3926 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2053 2.1883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4493 2.6119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8364 2.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5215 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8069 -1.9158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8077 -2.7386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5226 -3.1513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2345 -2.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2392 -1.9174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0930 -3.1511 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.9491 -3.1547 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.6748 1.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2807 2.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4097 1.5896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 1 1 0
5 6 1 6
6 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
7 12 1 0
13 10 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 13 2 0
14 18 1 0
3 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
20 24 1 0
24 25 1 0
25 26 1 0
26 27 1 0
20 27 1 0
1 28 1 1
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
30 34 1 0
32 35 1 0
17 36 1 0
16 37 1 0
37 38 1 0
38 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.67Molecular Weight (Monoisotopic): 526.3119AlogP: 4.96#Rotatable Bonds: 7Polar Surface Area: 61.60Molecular Species: ZWITTERIONHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.56CX Basic pKa: 9.88CX LogP: 1.59CX LogD: 1.24Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.55Np Likeness Score: -0.55
References 1. Gathiaka S, Palte RL, So SS, Chai X, Richard Miller J, Kuvelkar R, Wen X, Cifelli S, Kreamer A, Liaw A, McLaren DG, Fischer C.. (2023) Discovery of non-boronic acid Arginase 1 inhibitors through virtual screening and biophysical methods., 84 [PMID:36822300 ] [10.1016/j.bmcl.2023.129193 ]