1-(3-((4-amino-6-((3-(pentafluoro-lambda6-sulfaneyl)phenethyl)amino)-1,3,5-triazin-2-yl)methoxy)-5-methylphenyl)pyrrolidin-2-one

ID: ALA5284884

Max Phase: Preclinical

Molecular Formula: C23H25F5N6O2S

Molecular Weight: 544.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(OCc2nc(N)nc(NCCc3cccc(S(F)(F)(F)(F)F)c3)n2)cc(N2CCCC2=O)c1

Standard InChI:  InChI=1S/C23H25F5N6O2S/c1-15-10-17(34-9-3-6-21(34)35)13-18(11-15)36-14-20-31-22(29)33-23(32-20)30-8-7-16-4-2-5-19(12-16)37(24,25,26,27)28/h2,4-5,10-13H,3,6-9,14H2,1H3,(H3,29,30,31,32,33)

Standard InChI Key:  CTCNVMYZMOAOLR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    6.2514   -0.3548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6452    0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9452   -0.1993    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1201   -0.9838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9275   -1.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5485   -1.5555    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2451    0.2048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2436    1.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5432    1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8449    1.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8445    0.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5478   -0.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1446   -0.2014    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4444    0.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7443   -0.2014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7443   -1.0100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0486   -1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0486   -2.2219    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6534   -1.0136    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6534   -0.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0468    0.2022    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3535    0.2024    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0535   -0.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7535    0.2024    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4537   -0.2018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4537   -1.0101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1493   -1.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8512   -1.0138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8512   -0.2021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1510    0.2016    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5432    2.2219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5513    0.2020    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2514   -0.2021    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5513    1.0103    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2514    0.6062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8512    0.6062    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5513   -0.6064    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  4  6  2  0
  3  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12  7  2  0
 13 11  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 17 18  1  0
 19 17  2  0
 20 19  1  0
 21 20  2  0
 15 21  1  0
 22 20  1  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
  9 31  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 32 35  1  0
 32 36  1  0
 32 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284884

    ---

Associated Targets(Human)

FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 544.55Molecular Weight (Monoisotopic): 544.1680AlogP: 5.78#Rotatable Bonds: 9
Polar Surface Area: 106.26Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 5.18CX LogP: 5.78CX LogD: 5.77
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: -1.29

References

1. Lückmann M, Shenol A, Nissen TAD, Petersen JE, Kouvchinov D, Schwartz TW, Frimurer TM..  (2022)  Optimization of First-in-Class Dual-Acting FFAR1/FFAR4 Allosteric Modulators with Novel Mode of Action.,  13  (12.0): [PMID:36518697] [10.1021/acsmedchemlett.2c00160]

Source