N-((4-bromophenyl)sulfonyl)-2-((3-(4-cyclopropylnaphthalen-1-yl)-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-2-yl)thio)acetamide

ID: ALA5284974

Max Phase: Preclinical

Molecular Formula: C27H20BrN3O4S3

Molecular Weight: 626.58

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CSc1nc2sccc2c(=O)n1-c1ccc(C2CC2)c2ccccc12)NS(=O)(=O)c1ccc(Br)cc1

Standard InChI:  InChI=1S/C27H20BrN3O4S3/c28-17-7-9-18(10-8-17)38(34,35)30-24(32)15-37-27-29-25-22(13-14-36-25)26(33)31(27)23-12-11-19(16-5-6-16)20-3-1-2-4-21(20)23/h1-4,7-14,16H,5-6,15H2,(H,30,32)

Standard InChI Key:  DOVYBMLGVFODNY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 38 43  0  0  0  0  0  0  0  0999 V2000
   -2.9682    1.8214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9693    0.9964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6843    0.5848    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2553    0.5830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2564   -0.2419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9714   -0.6535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9724   -1.4786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2585   -1.8919    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2596   -2.7169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8480   -3.4320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6730   -3.4309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5435   -1.4804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8296   -1.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1146   -1.4822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1135   -0.6572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8275   -0.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5424   -0.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5403    0.9945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8263    0.5811    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1114    0.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6025    0.5793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6014   -0.2456    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3175    0.9908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0315    0.5774    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.7454    0.1640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6180   -0.1364    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4448    1.2914    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5392    1.8195    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2532    2.2330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4237    3.0401    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2441    3.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5806    2.3742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0333    2.0067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4462    2.7183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2717    2.7174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6827    2.0065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2736    1.2903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6843    3.4320    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
 11 10  1  0
  9 11  1  0
  8 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 17 16  1  0
 17  5  2  0
 12 17  1  0
  4 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 21 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  2  0
 24 27  1  0
 18 28  2  0
 29 28  1  0
 29  1  2  0
 30 29  1  0
 31 30  1  0
 32 31  2  0
  1 32  1  0
 33 27  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 27 37  1  0
 35 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5284974

    ---

Associated Targets(Human)

SLC22A12 Tclin Solute carrier family 22 member 12 (799 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC2A9 Tbio Solute carrier family 2, facilitated glucose transporter member 9 (15 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 626.58Molecular Weight (Monoisotopic): 624.9799AlogP: 5.84#Rotatable Bonds: 7
Polar Surface Area: 98.13Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.12CX Basic pKa: CX LogP: 6.47CX LogD: 5.53
Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -1.70

References

1. Zhang J, Dong Y, Gao S, Zhang X, Liao H, Shi X, Zhang Z, Zhao T, Liang R, Qi D, Wu T, Pang J, Liu X, Zhan P..  (2022)  Design, synthesis and activity evaluation of novel lesinurad analogues containing thienopyrimidinone or pyridine substructure as human urate transporter 1 inhibitors.,  244  [PMID:36219903] [10.1016/j.ejmech.2022.114816]

Source