The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-((4-bromophenyl)sulfonyl)-2-((3-(4-cyclopropylnaphthalen-1-yl)-4-oxo-3,4-dihydrothieno[2,3-d]pyrimidin-2-yl)thio)acetamide ID: ALA5284974
Max Phase: Preclinical
Molecular Formula: C27H20BrN3O4S3
Molecular Weight: 626.58
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CSc1nc2sccc2c(=O)n1-c1ccc(C2CC2)c2ccccc12)NS(=O)(=O)c1ccc(Br)cc1
Standard InChI: InChI=1S/C27H20BrN3O4S3/c28-17-7-9-18(10-8-17)38(34,35)30-24(32)15-37-27-29-25-22(13-14-36-25)26(33)31(27)23-12-11-19(16-5-6-16)20-3-1-2-4-21(20)23/h1-4,7-14,16H,5-6,15H2,(H,30,32)
Standard InChI Key: DOVYBMLGVFODNY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
-2.9682 1.8214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9693 0.9964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6843 0.5848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2553 0.5830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2564 -0.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9714 -0.6535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9724 -1.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2585 -1.8919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2596 -2.7169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8480 -3.4320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6730 -3.4309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5435 -1.4804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8296 -1.8938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1146 -1.4822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1135 -0.6572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8275 -0.2438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5424 -0.6554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5403 0.9945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8263 0.5811 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.1114 0.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6025 0.5793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6014 -0.2456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3175 0.9908 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0315 0.5774 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.7454 0.1640 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6180 -0.1364 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4448 1.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5392 1.8195 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2532 2.2330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4237 3.0401 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.2441 3.1275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5806 2.3742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0333 2.0067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4462 2.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2717 2.7174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6827 2.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2736 1.2903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6843 3.4320 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
9 8 1 0
9 10 1 0
11 10 1 0
9 11 1 0
8 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
17 16 1 0
17 5 2 0
12 17 1 0
4 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
23 24 1 0
24 25 2 0
24 26 2 0
24 27 1 0
18 28 2 0
29 28 1 0
29 1 2 0
30 29 1 0
31 30 1 0
32 31 2 0
1 32 1 0
33 27 2 0
34 33 1 0
35 34 2 0
36 35 1 0
37 36 2 0
27 37 1 0
35 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 626.58Molecular Weight (Monoisotopic): 624.9799AlogP: 5.84#Rotatable Bonds: 7Polar Surface Area: 98.13Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.12CX Basic pKa: ┄CX LogP: 6.47CX LogD: 5.53Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.18Np Likeness Score: -1.70
References 1. Zhang J, Dong Y, Gao S, Zhang X, Liao H, Shi X, Zhang Z, Zhao T, Liang R, Qi D, Wu T, Pang J, Liu X, Zhan P.. (2022) Design, synthesis and activity evaluation of novel lesinurad analogues containing thienopyrimidinone or pyridine substructure as human urate transporter 1 inhibitors., 244 [PMID:36219903 ] [10.1016/j.ejmech.2022.114816 ]