(2aS,2a1S,5S,5aR,6S,9aR)-8-(3,5-dimethoxybenzyl)-2a-isopropyl-2-tosyldodecahydro-6,9a-epoxyazepino[3,4,5-cd]indol-5-ol

ID: ALA5285041

Max Phase: Preclinical

Molecular Formula: C30H40N2O6S

Molecular Weight: 556.73

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(CN2C[C@H]3O[C@]4(C2)CN(S(=O)(=O)c2ccc(C)cc2)[C@]2(C(C)C)CC[C@H](O)[C@H]3[C@H]42)cc(OC)c1

Standard InChI:  InChI=1S/C30H40N2O6S/c1-19(2)30-11-10-25(33)27-26-16-31(15-21-12-22(36-4)14-23(13-21)37-5)17-29(38-26,28(27)30)18-32(30)39(34,35)24-8-6-20(3)7-9-24/h6-9,12-14,19,25-28,33H,10-11,15-18H2,1-5H3/t25-,26+,27+,28+,29+,30-/m0/s1

Standard InChI Key:  XIZIXODLDNHGGI-LEHZDZAPSA-N

Molfile:  

 
     RDKit          2D

 42 47  0  0  0  0  0  0  0  0999 V2000
   -2.3640    1.8455    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6496    1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0363    0.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5640    1.8679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0075    2.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2512    3.5559    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6496    2.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6496    3.0833    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3642    2.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3642    3.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0789    2.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0789    1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3642    1.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2847    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8681    1.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5251    0.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1927    0.2132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7761   -0.3701    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6011   -0.3701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1893    0.3457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5625   -1.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1484   -1.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9304   -2.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1370   -2.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9235   -3.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5535   -2.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7656   -1.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3720    0.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2027    2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1574    1.8456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9824    1.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3949    1.1312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2026    1.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2200    1.1310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6305    0.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2179   -0.2964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3970   -0.2979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9806    0.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4555    0.4183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8681    1.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9845   -1.0124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3970   -1.7269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  6
  5  4  1  0
  5  6  1  6
  7  5  1  0
  2  7  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  6
 11  9  1  0
 11 12  1  0
 12 13  1  0
  2 13  1  0
 13 14  1  1
 14 15  1  0
 14 16  1  0
 13 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  2  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 27 21  2  0
 28 17  1  0
  3 28  1  0
  5 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 30 33  1  0
  3 33  1  0
 34 32  2  0
 35 34  1  0
 36 35  2  0
 37 36  1  0
 38 37  2  0
 32 38  1  0
 35 39  1  0
 39 40  1  0
 37 41  1  0
 41 42  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285041

    ---

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.73Molecular Weight (Monoisotopic): 556.2607AlogP: 3.45#Rotatable Bonds: 7
Polar Surface Area: 88.54Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 6.21CX LogP: 3.35CX LogD: 3.32
Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.56Np Likeness Score: 0.02

References

1. Hassan H, Chiavaralli J, Hassan A, Bedda L, Krischuns T, Chen KY, Li ASM, Delpal A, Decroly E, Vedadi M, Naffakh N, Agou F, Mallart S, Arafa RK, Arimondo PB..  (2023)  Design and synthesis of naturally-inspired SARS-CoV-2 inhibitors.,  14  (3): [PMID:36970153] [10.1039/d2md00149g]

Source