The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-2-[4-(3-Diethylamino-2-hydroxypropoxy)phenyl]-5-hydroxy-7-methoxy-2,3-dihydrochromen-4-one ID: ALA5285046
Max Phase: Preclinical
Molecular Formula: C23H29NO6
Molecular Weight: 415.49
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)CC(O)COc1ccc([C@@H]2CC(=O)c3c(O)cc(OC)cc3O2)cc1
Standard InChI: InChI=1S/C23H29NO6/c1-4-24(5-2)13-16(25)14-29-17-8-6-15(7-9-17)21-12-20(27)23-19(26)10-18(28-3)11-22(23)30-21/h6-11,16,21,25-26H,4-5,12-14H2,1-3H3/t16?,21-/m0/s1
Standard InChI Key: CZUCENWGJVQINS-MRNPHLECSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
-1.4256 -2.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4256 -1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7141 -1.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7159 -0.2053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4307 0.2070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1432 -0.2037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1432 -1.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8531 -1.4403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8531 -2.2652 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5692 -1.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5692 -0.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2837 0.2083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9982 -0.2040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8548 0.2081 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7159 -0.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4275 0.2093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4260 1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7113 1.4427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0012 1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1404 1.4426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8548 1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 1.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2838 1.0301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 2.2676 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2838 0.2051 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.9982 -0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 -0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 -1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9982 -1.0322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 1 0
4 5 1 0
6 5 1 0
7 6 2 0
7 2 1 0
8 7 1 0
8 9 1 0
10 8 2 0
11 10 1 0
11 12 1 0
12 13 1 0
14 11 2 0
6 14 1 0
4 15 1 6
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 15 2 0
18 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
23 25 1 0
24 26 1 0
26 27 1 0
26 28 1 0
28 29 1 0
27 30 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.49Molecular Weight (Monoisotopic): 415.1995AlogP: 3.19#Rotatable Bonds: 9Polar Surface Area: 88.46Molecular Species: BASEHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.59CX Basic pKa: 9.36CX LogP: 2.38CX LogD: 1.43Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.65Np Likeness Score: 0.41
References 1. Ferreira RJ, Gajdács M, Kincses A, Spengler G, Dos Santos DJVA, Ferreira MU.. (2020) Nitrogen-containing naringenin derivatives for reversing multidrug resistance in cancer., 28 (23.0): [PMID:33038666 ] [10.1016/j.bmc.2020.115798 ]