(S)-5-(6-Chloro-5-fluoro-2-oxo-1,2-dihydrospiro[benzo[d][1,3]oxazine-4,3'-pyrrolidin]-1'-yl)-N-((6-((2-oxopyridin-1(2H)-yl)methyl)pyridin-3-yl)methyl)nicotinamide

ID: ALA5285047

Max Phase: Preclinical

Molecular Formula: C29H24ClFN6O4

Molecular Weight: 575.00

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C1Nc2ccc(Cl)c(F)c2[C@]2(CCN(c3cncc(C(=O)NCc4ccc(Cn5ccccc5=O)nc4)c3)C2)O1

Standard InChI:  InChI=1S/C29H24ClFN6O4/c30-22-6-7-23-25(26(22)31)29(41-28(40)35-23)8-10-37(17-29)21-11-19(14-32-15-21)27(39)34-13-18-4-5-20(33-12-18)16-36-9-2-1-3-24(36)38/h1-7,9,11-12,14-15H,8,10,13,16-17H2,(H,34,39)(H,35,40)/t29-/m1/s1

Standard InChI Key:  YTPBJIKJBISLLI-GDLZYMKVSA-N

Molfile:  

 
     RDKit          2D

 41 46  0  0  0  0  0  0  0  0999 V2000
   -3.8349    0.4080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2471    1.1226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8352    1.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0101    1.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5983    1.1244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0064    0.4080    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5976    2.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7727    2.5489    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3602    1.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5353    1.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1226    2.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6997    2.5481    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1124    1.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7033    1.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1210    1.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1158    0.4073    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9357    0.3212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1072   -0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3932   -0.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7804   -0.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1075   -1.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1075   -2.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3932   -2.5474    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6788   -2.1349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6788   -1.3100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0356   -2.5474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8251   -2.5489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5365   -2.1324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5346   -1.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8200   -0.8993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8200   -0.0744    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.2491   -0.8991    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.7727    1.1201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2473   -0.3063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8349   -1.0207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0099   -1.0210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5993   -1.7336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0119   -2.4482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8327   -2.4498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2491   -1.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5974   -0.3065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 16 14  1  0
 16 17  1  0
 17 18  1  0
 19 18  1  1
 19 20  1  0
 20 16  1  0
 19 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  1  0
 25 24  1  0
 19 25  1  0
 24 26  2  0
 22 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 21 30  1  0
 30 31  1  0
 29 32  1  0
  9 33  2  0
  1 34  1  0
 34 35  1  0
 36 35  1  0
 37 36  1  0
 38 37  2  0
 39 38  1  0
 40 39  2  0
 35 40  1  0
 36 41  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5285047

    ---

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 575.00Molecular Weight (Monoisotopic): 574.1532AlogP: 4.08#Rotatable Bonds: 6
Polar Surface Area: 118.45Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.49CX Basic pKa: 4.13CX LogP: 2.55CX LogD: 2.55
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.36Np Likeness Score: -1.34

References

1. Abdel-Magid AF..  (2023)  Plasma Kallikrein Inhibitors as Potential Treatment for Diabetic Macular Edema, Retinal Vein Occlusion, Hereditary Angioedema and Other Related Diseases.,  14  (2.0): [PMID:36793429] [10.1021/acsmedchemlett.2c00526]

Source