(1-(2-((Benzyloxy)amino)-2-oxoethyl)-1H-pyrrole-3-carbonyl)-L-alanyl-L-leucine

ID: ALA5285066

Max Phase: Preclinical

Molecular Formula: C23H30N4O6

Molecular Weight: 458.52

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)[C@H](C)NC(=O)c1ccn(CC(=O)NOCc2ccccc2)c1)C(=O)O

Standard InChI:  InChI=1S/C23H30N4O6/c1-15(2)11-19(23(31)32)25-21(29)16(3)24-22(30)18-9-10-27(12-18)13-20(28)26-33-14-17-7-5-4-6-8-17/h4-10,12,15-16,19H,11,13-14H2,1-3H3,(H,24,30)(H,25,29)(H,26,28)(H,31,32)/t16-,19-/m0/s1

Standard InChI Key:  ATRJMNXRBUGRJO-LPHOPBHVSA-N

Molfile:  

 
     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   -3.8419    0.2039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1274    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1274    1.4416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4128    0.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6982    0.6164    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9835    0.2038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2689    0.6164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9835   -0.6213    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1826    1.4366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6241    1.6082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0364    0.8938    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4845    0.2809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8617    0.8938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2743    0.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0995    0.1792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8617   -0.5353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5121   -0.5353    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3373   -0.5353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7499   -1.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5566    0.6165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2712    0.2039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9859    0.6165    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2712   -0.6212    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5566    1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2712    1.8543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5752   -1.2502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9859   -1.9631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5731   -2.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7520   -2.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3355   -1.9677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2712    2.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9859    1.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4128   -0.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  6  8  2  0
  9  7  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12  7  2  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  2  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
  1 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  2  0
 20 24  1  6
 24 25  1  0
 26 19  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 19 30  1  0
 25 31  1  0
 25 32  1  0
  4 33  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5285066

    ---

Associated Targets(Human)

MRC5 (9203 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mycobacterium tuberculosis variant bovis (1746 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Mycobacterium tuberculosis (203094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
RAW264.7 (28094 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.52Molecular Weight (Monoisotopic): 458.2165AlogP: 1.47#Rotatable Bonds: 12
Polar Surface Area: 138.76Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 3.79CX Basic pKa: CX LogP: 1.89CX LogD: -2.28
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: -0.76

References

1. Dak M, Šlachtová V, Šebela M, Bazgier V, Berka K, Smiejkowska N, Oorts L, Cappoen D, Brulíková L..  (2022)  Novel heterocyclic hydroxamates as inhibitors of the mycobacterial zinc metalloprotease Zmp1 to probe its mechanism of function.,  244  [PMID:36242986] [10.1016/j.ejmech.2022.114831]

Source