The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
methyl 7-methoxy-4-(3-methoxy-5-(1H-pyrazol-1-yl)phenoxy)quinoline-6-carboxylate ID: ALA5285074
Max Phase: Preclinical
Molecular Formula: C22H19N3O5
Molecular Weight: 405.41
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc2c(Oc3cc(OC)cc(-n4cccn4)c3)ccnc2cc1OC
Standard InChI: InChI=1S/C22H19N3O5/c1-27-15-9-14(25-8-4-6-24-25)10-16(11-15)30-20-5-7-23-19-13-21(28-2)18(12-17(19)20)22(26)29-3/h4-13H,1-3H3
Standard InChI Key: FNDDNEQGMGWYFO-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
1.8687 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1541 0.2064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4395 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4395 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1541 1.8554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8687 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1541 2.6800 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8687 3.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2749 0.2064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2749 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4395 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4395 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2749 -2.2670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9895 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9895 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7041 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4186 -1.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4186 -1.8547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7041 -2.2670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5833 0.2064 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5833 -0.6180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3803 -0.8653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8475 -0.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3528 0.4538 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1331 -0.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8475 -1.0302 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1331 0.2071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8475 -1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1331 -2.2672 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1331 -3.0922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
9 3 1 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
14 15 2 0
15 10 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 14 1 0
20 1 1 0
20 21 1 0
21 22 2 0
22 23 1 0
24 23 2 0
20 24 1 0
17 25 1 0
25 26 1 0
25 27 2 0
26 28 1 0
18 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 405.41Molecular Weight (Monoisotopic): 405.1325AlogP: 4.02#Rotatable Bonds: 6Polar Surface Area: 84.70Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 5.27CX LogP: 3.41CX LogD: 3.40Aromatic Rings: 4Heavy Atoms: 30QED Weighted: 0.45Np Likeness Score: -1.14
References 1. Lv G, Shi Q, Zhang T, Li J, Long Y, Zhang W, Choudhry N, Yang K, Li H, Kalashova J, Yang C, Zhou X, Reddy MC, Anantoju KK, Zhang S, Zhang J, Allen TD, Liu H, Nimishetti N, Yang D.. (2023) Integrating a phenotypic screening with a structural simplification strategy to identify 4-phenoxy-quinoline derivatives to potently disrupt the mitotic localization of Aurora kinase B., 80 [PMID:36696874 ] [10.1016/j.bmc.2023.117173 ]