The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-[3-[[4-(cyclopentanecarbonylamino)phenyl]carbamoyl]-2-methoxy-anilino]-6-(cyclopropanecarbonylamino)-N-(trideuteriomethyl)pyridazine-3-carboxamide ID: ALA5285091
Max Phase: Preclinical
Molecular Formula: C30H33N7O5
Molecular Weight: 571.64
Associated Items:
Names and Identifiers Canonical SMILES: [2H]C([2H])([2H])NC(=O)c1nnc(NC(=O)C2CC2)cc1Nc1cccc(C(=O)Nc2ccc(NC(=O)C3CCCC3)cc2)c1OC
Standard InChI: InChI=1S/C30H33N7O5/c1-31-30(41)25-23(16-24(36-37-25)35-28(39)18-10-11-18)34-22-9-5-8-21(26(22)42-2)29(40)33-20-14-12-19(13-15-20)32-27(38)17-6-3-4-7-17/h5,8-9,12-18H,3-4,6-7,10-11H2,1-2H3,(H,31,41)(H,32,38)(H,33,40)(H2,34,35,36,39)/i1D3
Standard InChI Key: PQYXVPVBGMNEHU-FIBGUPNXSA-N
Molfile:
RDKit 2D
45 49 0 0 0 0 0 0 0 0999 V2000
-0.3561 1.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3584 1.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0703 1.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0703 0.5671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3602 0.1553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3561 0.5634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3584 2.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3562 3.0419 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0731 3.0419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7876 2.6293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0707 1.8045 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7853 1.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0707 0.1508 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0707 -0.6743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5025 3.0418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 2.6298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 1.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5043 1.3924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7876 1.8006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 1.3917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9292 0.5665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6438 0.1540 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 0.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2146 -0.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4105 -0.9213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9396 -0.2677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4317 0.3998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7853 -1.0872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7845 -1.9099 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0697 -2.3226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3578 -1.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3530 -1.0887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3567 -2.3259 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0714 -1.9134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7860 -2.3259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0714 -1.0882 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1994 -3.0419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6112 -2.3269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 -0.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2146 -1.0872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4999 0.1505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9292 -0.6745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6438 -1.0872 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.9292 0.1505 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.6438 -0.2619 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
7 8 2 0
7 9 1 0
9 10 1 0
1 11 1 0
11 12 1 0
6 13 1 0
13 14 1 0
15 10 2 0
16 15 1 0
17 16 2 0
18 17 1 0
19 18 2 0
10 19 1 0
17 20 1 0
20 21 1 0
21 22 2 0
21 23 1 0
24 23 1 0
24 25 1 0
25 26 1 0
27 26 1 0
23 27 1 0
28 14 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
14 32 1 0
31 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
37 35 1 0
37 38 1 0
35 38 1 0
28 39 1 0
39 40 1 0
39 41 2 0
40 42 1 0
42 43 1 0
42 44 1 0
42 45 1 0
M ISO 3 43 2 44 2 45 2
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 571.64Molecular Weight (Monoisotopic): 571.2543AlogP: 4.32#Rotatable Bonds: 10Polar Surface Area: 163.44Molecular Species: NEUTRALHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.08CX Basic pKa: 3.35CX LogP: 4.43CX LogD: 4.43Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.24Np Likeness Score: -1.14
References 1. Liu F, Wang B, Liu Y, Shi W, Hu Z, Chang X, Tang X, Zhang Y, Xu H, He Y.. (2023) Design, synthesis and biological evaluation of novel N-(methyl-d3 ) pyridazine-3-carboxamide derivatives as TYK2 inhibitors., 86 [PMID:36907336 ] [10.1016/j.bmcl.2023.129235 ]