1-(3-((4-amino-6-((2,4-dichlorophenethyl)amino)-1,3,5-triazin-2-yl)methoxy)-5-methylphenyl)pyrrolidin-2-one

ID: ALA5285104

Max Phase: Preclinical

Molecular Formula: C23H24Cl2N6O2

Molecular Weight: 487.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(OCc2nc(N)nc(NCCc3ccc(Cl)cc3Cl)n2)cc(N2CCCC2=O)c1

Standard InChI:  InChI=1S/C23H24Cl2N6O2/c1-14-9-17(31-8-2-3-21(31)32)12-18(10-14)33-13-20-28-22(26)30-23(29-20)27-7-6-15-4-5-16(24)11-19(15)25/h4-5,9-12H,2-3,6-8,13H2,1H3,(H3,26,27,28,29,30)

Standard InChI Key:  DIPGWWHTULJLDQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -5.3126   -1.0355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5957   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8852   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8852   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5975    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3126   -0.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1701    0.2067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4550   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7400    0.2067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0249   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3097    0.2065    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4028   -0.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1179    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8330   -0.2057    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5480    0.2071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5483    1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2615    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2615    2.2695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9768    1.0308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9785    0.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2662   -0.2074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6935   -0.2035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4086    0.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0277   -0.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6968   -1.0974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8721   -1.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2883   -1.5889    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4028   -1.0316    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3078   -1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0249   -1.0353    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3078   -2.2695    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5975    1.0317    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -6.0277   -1.4483    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  4  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 17 18  1  0
 19 17  2  0
 20 19  1  0
 21 20  2  0
 15 21  1  0
 22 20  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 26 25  1  0
 22 26  1  0
 26 27  2  0
 28 12  2  0
 29 28  1  0
 30 29  2  0
 10 30  1  0
 29 31  1  0
  5 32  1  0
  1 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285104

    ---

Associated Targets(Human)

FFAR1 Tchem Free fatty acid receptor 1 (4763 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FFAR4 Tchem G-protein coupled receptor 120 (2999 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.39Molecular Weight (Monoisotopic): 486.1338AlogP: 4.43#Rotatable Bonds: 8
Polar Surface Area: 106.26Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 5.18CX LogP: 4.81CX LogD: 4.80
Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -1.79

References

1. Lückmann M, Shenol A, Nissen TAD, Petersen JE, Kouvchinov D, Schwartz TW, Frimurer TM..  (2022)  Optimization of First-in-Class Dual-Acting FFAR1/FFAR4 Allosteric Modulators with Novel Mode of Action.,  13  (12.0): [PMID:36518697] [10.1021/acsmedchemlett.2c00160]

Source