ID: ALA5285148

Max Phase: Preclinical

Molecular Formula: C28H41NO7

Molecular Weight: 503.64

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(O[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)c1ccc(CN2CCOCC2)c(O)c1

Standard InChI:  InChI=1S/C28H41NO7/c1-17-5-8-23-18(2)25(33-26-28(23)22(17)9-10-27(4,34-26)35-36-28)32-19(3)20-6-7-21(24(30)15-20)16-29-11-13-31-14-12-29/h6-7,15,17-19,22-23,25-26,30H,5,8-14,16H2,1-4H3/t17-,18-,19?,22+,23+,25+,26-,27-,28-/m1/s1

Standard InChI Key:  QPCQZWPHWUHSCI-GSHVLGPMSA-N

Molfile:  

 
     RDKit          2D

 39 44  0  0  0  0  0  0  0  0999 V2000
    2.1429    1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8574    2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5720    1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5720    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8574    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1429    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8574   -0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1429   -0.8252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282   -0.4126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4978    2.1635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6963    1.9714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3363    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6964    0.4985    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4282    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8574    2.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5717   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1429   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4286   -2.0623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4883    1.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2343    1.6865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2343    0.8984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7113   -1.6482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4286   -2.8871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0031   -2.0604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148   -1.6486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148   -0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0049   -0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7113   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4291   -2.0610    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4291   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -0.8236    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8577   -0.4112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434   -1.6483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8577   -2.0607    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -0.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5720   -1.6483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1429   -0.0001    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2292    2.4703    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8153   -0.1397    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  8  7  1  0
  9  8  1  0
  1 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  6 14  1  0
 14  9  1  0
  2 15  1  6
  7 16  1  1
  8 17  1  1
 17 18  1  0
 12 19  1  0
 12 20  1  6
 20 21  1  0
  6 21  1  6
 18 22  1  0
 18 23  1  0
 24 22  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 22 28  1  0
 25 29  1  0
 26 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 32 35  1  0
 35 36  1  0
 36 34  1  0
  5 37  1  6
  1 38  1  6
 14 39  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5285148

    ---

Associated Targets(non-human)

Plasmodium berghei (192651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.2883AlogP: 4.51#Rotatable Bonds: 5
Polar Surface Area: 78.85Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.61CX Basic pKa: 7.18CX LogP: 4.85CX LogD: 4.78
Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.59Np Likeness Score: 1.68

References

1. Patel OPS, Beteck RM, Legoabe LJ..  (2021)  Exploration of artemisinin derivatives and synthetic peroxides in antimalarial drug discovery research.,  213  [PMID:33508479] [10.1016/j.ejmech.2021.113193]

Source