The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5285148
Max Phase: Preclinical
Molecular Formula: C28H41NO7
Molecular Weight: 503.64
Associated Items:
Names and Identifiers Canonical SMILES: CC(O[C@H]1O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]([C@H]1C)[C@@]24OO3)c1ccc(CN2CCOCC2)c(O)c1
Standard InChI: InChI=1S/C28H41NO7/c1-17-5-8-23-18(2)25(33-26-28(23)22(17)9-10-27(4,34-26)35-36-28)32-19(3)20-6-7-21(24(30)15-20)16-29-11-13-31-14-12-29/h6-7,15,17-19,22-23,25-26,30H,5,8-14,16H2,1-4H3/t17-,18-,19?,22+,23+,25+,26-,27-,28-/m1/s1
Standard InChI Key: QPCQZWPHWUHSCI-GSHVLGPMSA-N
Molfile:
RDKit 2D
39 44 0 0 0 0 0 0 0 0999 V2000
2.1429 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8574 2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5720 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5720 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8574 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1429 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8574 -0.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1429 -0.8252 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4282 -0.4126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4978 2.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6963 1.9714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3363 1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6964 0.4985 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4282 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8574 2.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5717 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1429 -1.6500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 -2.0623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4883 1.2373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2343 1.6865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2343 0.8984 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7113 -1.6482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4286 -2.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -2.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7148 -1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7148 -0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0049 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7113 -0.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4291 -2.0610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4291 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1434 -0.8236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 -0.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1434 -1.6483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 -2.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5720 -0.8236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5720 -1.6483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1429 -0.0001 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.2292 2.4703 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.8153 -0.1397 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
5 7 1 0
8 7 1 0
9 8 1 0
1 10 1 0
10 11 1 0
12 11 1 0
13 12 1 0
14 13 1 0
6 14 1 0
14 9 1 0
2 15 1 6
7 16 1 1
8 17 1 1
17 18 1 0
12 19 1 0
12 20 1 6
20 21 1 0
6 21 1 6
18 22 1 0
18 23 1 0
24 22 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
22 28 1 0
25 29 1 0
26 30 1 0
30 31 1 0
31 32 1 0
31 33 1 0
33 34 1 0
32 35 1 0
35 36 1 0
36 34 1 0
5 37 1 6
1 38 1 6
14 39 1 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.64Molecular Weight (Monoisotopic): 503.2883AlogP: 4.51#Rotatable Bonds: 5Polar Surface Area: 78.85Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.61CX Basic pKa: 7.18CX LogP: 4.85CX LogD: 4.78Aromatic Rings: 1Heavy Atoms: 36QED Weighted: 0.59Np Likeness Score: 1.68
References 1. Patel OPS, Beteck RM, Legoabe LJ.. (2021) Exploration of artemisinin derivatives and synthetic peroxides in antimalarial drug discovery research., 213 [PMID:33508479 ] [10.1016/j.ejmech.2021.113193 ]