The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[[(2S)-2-[(4-bromo-2-fluoro-phenyl)carbamoylamino]-4-methyl-pentanoyl]amino]acetic acid ID: ALA5285150
Max Phase: Preclinical
Molecular Formula: C15H19BrFN3O4
Molecular Weight: 404.24
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](NC(=O)Nc1ccc(Br)cc1F)C(=O)NCC(=O)O
Standard InChI: InChI=1S/C15H19BrFN3O4/c1-8(2)5-12(14(23)18-7-13(21)22)20-15(24)19-11-4-3-9(16)6-10(11)17/h3-4,6,8,12H,5,7H2,1-2H3,(H,18,23)(H,21,22)(H2,19,20,24)/t12-/m0/s1
Standard InChI Key: GWOULRCUFTYSHG-LBPRGKRZSA-N
Molfile:
RDKit 2D
24 24 0 0 0 0 0 0 0 0999 V2000
-3.5569 0.4104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5569 -0.4145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8435 -0.8209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1364 -0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1364 0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8453 0.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4247 0.8217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7130 0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0013 0.8217 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7103 0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 0.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 1.6435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1336 0.4108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8453 0.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5570 0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2686 0.8217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5570 -0.4108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7103 -0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 -0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4219 -1.6435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1336 -0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7130 -0.4108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2686 -0.8254 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-1.4247 -0.8218 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
7 8 1 0
8 9 1 0
10 9 1 6
10 11 1 0
11 12 2 0
11 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
15 17 2 0
10 18 1 0
18 19 1 0
19 20 1 0
19 21 1 0
8 22 2 0
2 23 1 0
4 24 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 404.24Molecular Weight (Monoisotopic): 403.0543AlogP: 2.33#Rotatable Bonds: 7Polar Surface Area: 107.53Molecular Species: ACIDHBA: 3HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.55CX Basic pKa: ┄CX LogP: 2.21CX LogD: -1.15Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.56Np Likeness Score: -1.27
References 1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM.. (2021) Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential., 213 [PMID:33486199 ] [10.1016/j.ejmech.2021.113167 ]