(2aS,2a1S,5S,5aR,6S,9aR)-5-hydroxy-2a-isopropyl-N-methyl-2-tosyldecahydro-6,9a-epoxyazepino[3,4,5-cd]indole-8(9H)-carboxamide

ID: ALA5285161

Max Phase: Preclinical

Molecular Formula: C23H33N3O5S

Molecular Weight: 463.60

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CNC(=O)N1C[C@H]2O[C@]3(C1)CN(S(=O)(=O)c1ccc(C)cc1)[C@]1(C(C)C)CC[C@H](O)[C@H]2[C@H]31

Standard InChI:  InChI=1S/C23H33N3O5S/c1-14(2)23-10-9-17(27)19-18-11-25(21(28)24-4)12-22(31-18,20(19)23)13-26(23)32(29,30)16-7-5-15(3)6-8-16/h5-8,14,17-20,27H,9-13H2,1-4H3,(H,24,28)/t17-,18+,19+,20+,22+,23-/m0/s1

Standard InChI Key:  ANSHAZSNFPGMAO-DJIRWREJSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -1.5399    1.8455    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8255    1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2122    0.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2600    1.8679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1833    2.7677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4271    3.5559    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8255    2.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8255    3.0833    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5401    2.6709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5401    3.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2548    2.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2548    1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5401    1.0204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4606    0.8068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0439    1.3902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7009    0.0176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3686    0.2132    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9520   -0.3701    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7770   -0.3701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3652    0.3457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7384   -1.1670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3243   -1.7528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1062   -2.5480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3129   -2.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0994   -3.5559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7294   -2.1754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9415   -1.3807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5479    0.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6214    2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9815    1.8456    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8065    1.8456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6214    1.1114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2189    1.1312    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2189    2.5602    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.0439    2.5602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  2  3  1  0
  3  4  1  6
  5  4  1  0
  5  6  1  6
  7  5  1  0
  2  7  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  6
 11  9  1  0
 11 12  1  0
 12 13  1  0
  2 13  1  0
 13 14  1  1
 14 15  1  0
 14 16  1  0
 13 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  2  0
 18 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  1  0
 24 26  2  0
 26 27  1  0
 27 21  2  0
 28 17  1  0
  3 28  1  0
  5 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
  3 32  1  0
 31 33  2  0
 31 34  1  0
 34 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285161

    ---

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 463.60Molecular Weight (Monoisotopic): 463.2141AlogP: 1.57#Rotatable Bonds: 3
Polar Surface Area: 99.18Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.06CX LogD: 1.06
Aromatic Rings: 1Heavy Atoms: 32QED Weighted: 0.71Np Likeness Score: 0.05

References

1. Hassan H, Chiavaralli J, Hassan A, Bedda L, Krischuns T, Chen KY, Li ASM, Delpal A, Decroly E, Vedadi M, Naffakh N, Agou F, Mallart S, Arafa RK, Arimondo PB..  (2023)  Design and synthesis of naturally-inspired SARS-CoV-2 inhibitors.,  14  (3): [PMID:36970153] [10.1039/d2md00149g]

Source