ethyl 6-oxo-4,5,6,11-tetrahydro-2H-pyrrolo[3',4':5,6]azepino[4,3-b]indole-1-carboxylate

ID: ALA5285173

Max Phase: Preclinical

Molecular Formula: C17H15N3O3

Molecular Weight: 309.33

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)c1[nH]cc2c1-c1[nH]c3ccccc3c1C(=O)NC2

Standard InChI:  InChI=1S/C17H15N3O3/c1-2-23-17(22)15-12-9(7-18-15)8-19-16(21)13-10-5-3-4-6-11(10)20-14(12)13/h3-7,18,20H,2,8H2,1H3,(H,19,21)

Standard InChI Key:  BWHNMECMUBMMQO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 23 26  0  0  0  0  0  0  0  0999 V2000
   -2.5941    0.8336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8795    1.2459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1676    0.8340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1676    0.0088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8777   -0.4029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5941    0.0051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3828   -0.2461    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3828    1.0889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1021    0.4213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9260    0.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4617    1.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3214    1.8170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5958    2.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1627    1.8784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3563   -0.3180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2230    0.6957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1579   -0.1260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7462    2.4619    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.9437   -1.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3563   -1.7472    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1185   -1.0326    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1815   -1.7472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5941   -2.4619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  9  7  1  0
  9 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  8 14  1  0
 10 15  2  0
 11 16  2  0
 16 17  1  0
 17 15  1  0
 14 18  2  0
 15 19  1  0
 19 20  1  0
 19 21  2  0
 20 22  1  0
 22 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285173

    ---

Associated Targets(Human)

MAP3K7 Tchem Mitogen-activated protein kinase kinase kinase 7 (1167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 309.33Molecular Weight (Monoisotopic): 309.1113AlogP: 2.58#Rotatable Bonds: 2
Polar Surface Area: 86.98Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 10.66CX Basic pKa: CX LogP: 1.82CX LogD: 1.82
Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.64Np Likeness Score: 0.18

References

1. Akunuri R, Vadakattu M, Bujji S, Veerareddy V, Madhavi YV, Nanduri S..  (2021)  Fused-azepinones: Emerging scaffolds of medicinal importance.,  220  [PMID:33901899] [10.1016/j.ejmech.2021.113445]

Source