The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-(4-(7-cyano-5-(4-methoxyphenyl)-4-oxo-4,5-dihydro-3H-pyrrolo[3,2-d]pyrimidin-3-yl)phenyl)pyrrolidine-2-carboxamide ID: ALA5285200
Max Phase: Preclinical
Molecular Formula: C25H22N6O3
Molecular Weight: 454.49
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-n2cc(C#N)c3ncn(-c4ccc(N5CCC[C@H]5C(N)=O)cc4)c(=O)c32)cc1
Standard InChI: InChI=1S/C25H22N6O3/c1-34-20-10-8-18(9-11-20)30-14-16(13-26)22-23(30)25(33)31(15-28-22)19-6-4-17(5-7-19)29-12-2-3-21(29)24(27)32/h4-11,14-15,21H,2-3,12H2,1H3,(H2,27,32)/t21-/m0/s1
Standard InChI Key: QIBGYXZHFXJNMM-NRFANRHFSA-N
Molfile:
RDKit 2D
34 38 0 0 0 0 0 0 0 0999 V2000
-1.5803 -0.5897 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8657 -0.1774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1539 -0.5891 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.1539 -1.4144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8639 -1.8262 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5803 -1.4181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3682 -1.6741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3682 -0.3337 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8551 -1.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5825 0.4663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3826 0.6808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5956 1.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0098 2.0646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2133 1.8528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9944 1.0545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5634 -0.1751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5636 0.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2790 1.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9967 0.6511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9982 -0.1729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2837 -0.5910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7139 1.0652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2241 2.8645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0242 3.0790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5825 -2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7969 -3.2742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8657 0.6508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8003 1.8885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6102 2.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0242 1.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4702 0.7285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2148 2.4742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4147 2.2597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4291 3.2742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 1 0
5 4 2 0
1 6 2 0
6 5 1 0
6 7 1 0
1 8 1 0
8 9 1 0
9 7 2 0
10 8 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
10 15 1 0
15 14 2 0
16 3 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
16 21 1 0
21 20 2 0
22 19 1 0
13 23 1 0
23 24 1 0
7 25 1 0
25 26 3 0
2 27 2 0
28 22 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 22 1 0
28 32 1 6
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 454.49Molecular Weight (Monoisotopic): 454.1753AlogP: 2.51#Rotatable Bonds: 5Polar Surface Area: 119.17Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.58CX LogD: 2.58Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.49Np Likeness Score: -0.83
References 1. Yang J, Su B, Liao R, Wang J, Bo S.. (2023) Synthesis of pyrrolo[3,2-d]pyrimidineone derivatives as novel FXa inhibitors., 80 [PMID:36634753 ] [10.1016/j.bmcl.2023.129127 ]