The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2S,3S,4S)-1-(4-(((3R,4R)-1-(5-chloro-2-methoxypyridin-4-yl)-3-methylpiperidin-4-yl)oxy)phenyl)-4-fluoro-3-methoxypyrrolidin-2-yl)acetic acid ID: ALA5285235
Max Phase: Preclinical
Molecular Formula: C25H31ClFN3O5
Molecular Weight: 507.99
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CC[C@@H](Oc3ccc(N4C[C@H](F)[C@@H](OC)[C@@H]4CC(=O)O)cc3)[C@H](C)C2)c(Cl)cn1
Standard InChI: InChI=1S/C25H31ClFN3O5/c1-15-13-29(20-10-23(33-2)28-12-18(20)26)9-8-22(15)35-17-6-4-16(5-7-17)30-14-19(27)25(34-3)21(30)11-24(31)32/h4-7,10,12,15,19,21-22,25H,8-9,11,13-14H2,1-3H3,(H,31,32)/t15-,19+,21+,22-,25-/m1/s1
Standard InChI Key: GOIBKNSIPDPUKI-CEWBVGSFSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
0.3642 1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0787 1.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7907 1.3919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7907 0.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0806 0.1550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3642 0.5632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5053 0.1543 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2588 0.4898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8107 -0.1231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3983 -0.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5914 -0.6659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0083 -1.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2218 -2.0456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6386 -2.6286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0184 -2.2590 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3499 1.8041 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0641 1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0641 0.5669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7783 0.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4925 0.5669 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4925 1.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7783 1.8041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7783 2.6286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2067 0.1547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2069 -0.6699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9194 -1.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6337 -0.6679 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.6353 0.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9239 0.5688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9239 1.3934 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.9194 -1.9051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2051 -2.3173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8106 -1.5516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6353 -1.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6353 -0.1231 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
7 4 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 7 1 0
11 12 1 6
12 13 1 0
13 14 1 0
13 15 2 0
1 16 1 0
17 16 1 6
18 17 1 0
19 18 1 0
20 19 1 0
21 20 1 0
22 21 1 0
17 22 1 0
22 23 1 1
24 20 1 0
25 24 2 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 2 0
24 29 1 0
29 30 1 0
26 31 1 0
31 32 1 0
10 33 1 1
33 34 1 0
9 35 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 507.99Molecular Weight (Monoisotopic): 507.1936AlogP: 4.05#Rotatable Bonds: 8Polar Surface Area: 84.36Molecular Species: ACIDHBA: 7HBD: 1#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.30CX Basic pKa: 5.78CX LogP: 2.67CX LogD: 1.20Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.57Np Likeness Score: -0.27
References 1. Jurica EA, Wu X, Williams KN, Haque LE, Rampulla RA, Mathur A, Zhou M, Cao G, Cai H, Wang T, Liu H, Xu C, Kunselman LK, Antrilli TM, Hicks MB, Sun Q, Dierks EA, Apedo A, Moore DB, Foster KA, Cvijic ME, Panemangalore R, Khandelwal P, Wilkes JJ, Zinker BA, Robertson DG, Janovitz EB, Galella M, Li YX, Li J, Ramar T, Jalagam PR, Jayaram R, Whaley JM, Barrish JC, Robl JA, Ewing WR, Ellsworth BA.. (2023) Optimization of physicochemical properties of pyrrolidine GPR40 AgoPAMs results in a differentiated profile with improved pharmacokinetics and reduced off-target activities., 85 [PMID:37030194 ] [10.1016/j.bmc.2023.117273 ]