1-(4-(((5S,6S,9S)-5-(4-fluorophenyl)-9-(2-(trifluoromethoxy)phenyl)-1,7-dioxa-4-azaspiro[5.5]undecan-4-yl)methyl)-1H-1,2,3-triazol-5-yl)-N,N-dimethylmethanamine

ID: ALA5285318

Max Phase: Preclinical

Molecular Formula: C27H31F4N5O3

Molecular Weight: 549.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CN(C)Cc1[nH]nnc1CN1CCO[C@@]2(CC[C@@H](c3ccccc3OC(F)(F)F)CO2)[C@@H]1c1ccc(F)cc1

Standard InChI:  InChI=1S/C27H31F4N5O3/c1-35(2)15-22-23(33-34-32-22)16-36-13-14-37-26(25(36)18-7-9-20(28)10-8-18)12-11-19(17-38-26)21-5-3-4-6-24(21)39-27(29,30)31/h3-10,19,25H,11-17H2,1-2H3,(H,32,33,34)/t19-,25+,26-/m1/s1

Standard InChI Key:  GXDHHASFXFRRTG-JSRBVGTNSA-N

Molfile:  

 
     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -3.6743   -2.0419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0910   -1.4585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3045   -0.6616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2941   -1.6721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0805   -2.4690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3272   -2.8043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4135   -3.6244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2201   -3.7959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6324   -3.0817    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6128   -2.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6128   -1.5668    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3275   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3275   -0.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6128    0.0836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018   -0.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8163   -0.7414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5307   -0.3290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5307    0.4959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2454    0.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9627    0.4942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6743    0.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6743    1.7314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9581    2.1440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2454    1.7334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5309    2.1459    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5309    2.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8165    3.3834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2454    3.3834    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.5309    3.7959    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.8162    0.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018    0.4959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1018   -1.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8163   -1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8163   -2.3952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5327   -2.8034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2428   -2.3915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9573   -2.8041    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.2428   -1.5663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5309   -1.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  4  2  1  0
  5  4  1  0
  5  6  2  0
  7  6  1  0
  7  8  2  0
  9  5  1  0
  8  9  1  0
 10  6  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 13 14  1  0
 15 14  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  6
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 19  2  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 26 29  1  0
 18 30  1  0
 30 31  1  0
 15 31  1  6
 11 32  1  0
 32 15  1  0
 32 33  1  6
 33 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  1  0
 36 38  2  0
 38 39  1  0
 39 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5285318

    ---

Associated Targets(Human)

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 549.57Molecular Weight (Monoisotopic): 549.2363AlogP: 4.77#Rotatable Bonds: 7
Polar Surface Area: 75.74Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.14CX Basic pKa: 6.87CX LogP: 5.28CX LogD: 5.36
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.43Np Likeness Score: -0.55

References

1. Wu YJ, Meanwell NA..  (2021)  Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design.,  64  (14.0): [PMID:34213340] [10.1021/acs.jmedchem.1c00790]

Source