The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5285363
Max Phase: Preclinical
Molecular Formula: C28H29Cl2FN8O
Molecular Weight: 583.50
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(Nc2ncc3c(n2)N2CCN=C2N(c2c(Cl)cccc2Cl)C3=O)cc(F)c1N1CCC(N(C)C)CC1
Standard InChI: InChI=1S/C28H29Cl2FN8O/c1-16-13-17(14-22(31)23(16)37-10-7-18(8-11-37)36(2)3)34-27-33-15-19-25(35-27)38-12-9-32-28(38)39(26(19)40)24-20(29)5-4-6-21(24)30/h4-6,13-15,18H,7-12H2,1-3H3,(H,33,34,35)
Standard InChI Key: YFNATPFSAZZDDV-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
-2.1336 -0.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1336 -0.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4251 0.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 -0.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 -0.9896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4251 -1.4063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0037 -1.3963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7032 -0.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7032 -0.1630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4110 0.2534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1228 -0.1608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1228 -0.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4136 -1.3914 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8359 0.2509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5491 -0.1608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5491 -0.9843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8359 -1.3961 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2571 0.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2573 1.0653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9635 1.4722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6717 1.0633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6732 0.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9681 -0.1626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5494 1.4741 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.9681 -0.9800 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.8359 1.0684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1666 -1.5545 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8366 -2.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0141 -2.1954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4251 1.0610 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8415 -1.3984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8415 0.2440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5494 -0.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2573 0.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2573 1.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5494 1.4702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8415 1.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9653 1.4702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6732 1.0615 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9653 2.2877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
1 6 1 0
5 7 1 0
7 8 1 0
9 8 2 0
9 10 1 0
11 10 2 0
12 11 1 0
8 13 1 0
13 12 2 0
11 14 1 0
15 14 1 0
16 15 1 0
17 16 1 0
12 17 1 0
15 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
19 24 1 0
23 25 1 0
14 26 2 0
16 27 2 0
27 28 1 0
29 28 1 0
17 29 1 0
3 30 1 0
1 31 1 0
2 32 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
32 37 1 0
35 38 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 583.50Molecular Weight (Monoisotopic): 582.1825AlogP: 5.34#Rotatable Bonds: 5Polar Surface Area: 80.20Molecular Species: BASEHBA: 8HBD: 1#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.30CX Basic pKa: 9.78CX LogP: 5.65CX LogD: 3.30Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.43Np Likeness Score: -1.53
References 1. Guler S, DiPoto MC, Crespo A, Caldwell R, Doerfel B, Grossmann N, Ho K, Huck B, Jones CC, Lan R, Musil D, Potnick J, Schilke H, Sherer B, Simon S, Sirrenberg C, Zhang Z, Liu-Bujalski L.. (2023) Selective Wee1 Inhibitors Led to Antitumor Activity In Vitro and Correlated with Myelosuppression., 14 (5): [PMID:37197456 ] [10.1021/acsmedchemlett.2c00481 ]