The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5285377
Max Phase: Preclinical
Molecular Formula: C21H20N4O3
Molecular Weight: 376.42
Associated Items:
Names and Identifiers Canonical SMILES: COCc1c(-c2cc(C)on2)ncc2[nH]c3ccc4oc(C(C)C)nc4c3c12
Standard InChI: InChI=1S/C21H20N4O3/c1-10(2)21-24-20-16(27-21)6-5-13-18(20)17-12(9-26-4)19(22-8-15(17)23-13)14-7-11(3)28-25-14/h5-8,10,23H,9H2,1-4H3
Standard InChI Key: YJZGQBGGTBIAOP-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
1.6214 -1.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8005 -1.3898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3185 -0.7204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6571 0.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4779 0.1145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9600 -0.5548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5050 -0.9766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5050 -1.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2966 -2.0735 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2322 -2.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9658 -1.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9658 -0.9771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2340 -0.5548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2447 0.7460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5800 0.7460 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9924 1.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8903 0.8288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4780 1.5431 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0490 2.1616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7832 1.8310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6910 1.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5991 -0.3919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2603 0.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4165 0.2652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6727 1.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4976 1.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2603 1.7886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4976 2.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
3 4 1 0
4 5 2 0
6 5 1 0
1 6 2 0
7 3 1 0
8 7 2 0
8 9 1 0
9 2 1 0
10 8 1 0
11 10 2 0
12 11 1 0
13 12 2 0
7 13 1 0
4 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
18 17 2 0
18 19 1 0
19 20 1 0
21 20 2 0
17 21 1 0
12 22 1 0
22 23 1 0
24 23 2 0
13 24 1 0
23 25 1 0
25 26 1 0
25 27 1 0
20 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 376.42Molecular Weight (Monoisotopic): 376.1535AlogP: 5.09#Rotatable Bonds: 4Polar Surface Area: 89.97Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.69CX Basic pKa: 0.69CX LogP: 3.45CX LogD: 3.45Aromatic Rings: 5Heavy Atoms: 28QED Weighted: 0.47Np Likeness Score: -0.61
References 1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R.. (2021) β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy., 64 (3.0): [PMID:33528252 ] [10.1021/acs.jmedchem.0c01887 ]