2-([1,2,4]triazolo[4,3-a]quinoxalin-4-ylthio)-N-(4-(N-(pyridin-2-yl)sulfamoyl)phenyl)acetamide

ID: ALA5285408

Max Phase: Preclinical

Molecular Formula: C22H17N7O3S2

Molecular Weight: 491.56

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(CSc1nc2ccccc2n2cnnc12)Nc1ccc(S(=O)(=O)Nc2ccccn2)cc1

Standard InChI:  InChI=1S/C22H17N7O3S2/c30-20(13-33-22-21-27-24-14-29(21)18-6-2-1-5-17(18)26-22)25-15-8-10-16(11-9-15)34(31,32)28-19-7-3-4-12-23-19/h1-12,14H,13H2,(H,23,28)(H,25,30)

Standard InChI Key:  LHFXYOYUZZPXSR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 38  0  0  0  0  0  0  0  0999 V2000
   -5.6892    1.1925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6892    0.3675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9758   -0.0388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2687    0.3712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2687    1.1929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9776    1.6031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5590    1.6020    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8454    1.1913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8454    0.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5540   -0.0411    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1337   -0.0370    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4221    0.3737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7105   -0.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0010    0.3737    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7126   -0.0370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4244    0.3736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1335   -0.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1335   -0.8585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4262   -1.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7126   -0.8622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8451   -1.2694    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5567   -0.8585    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.2683   -1.2694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9801   -0.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6892   -1.2690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6892   -2.0910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9819   -2.5011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2683   -2.0947    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4335   -1.9823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2552   -1.9823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7105   -0.8587    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2453    1.7443    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5764    2.5011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3746    2.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 15 20  1  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 23 28  1  0
 21 29  2  0
 21 30  2  0
 13 31  2  0
  8 32  2  0
 32 33  1  0
 34 33  2  0
  7 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285408

    ---

Associated Targets(Human)

TOP2A Tclin DNA topoisomerase II (1334 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 491.56Molecular Weight (Monoisotopic): 491.0834AlogP: 3.20#Rotatable Bonds: 7
Polar Surface Area: 131.24Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.01CX Basic pKa: 1.44CX LogP: 1.67CX LogD: 1.24
Aromatic Rings: 5Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: -2.28

References

1. Aggarwal R, Sumran G..  (2020)  An insight on medicinal attributes of 1,2,4-triazoles.,  205  [PMID:32771798] [10.1016/j.ejmech.2020.112652]

Source