The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
11-epi-sinulariolide acetate ID: ALA5285409
Max Phase: Preclinical
Molecular Formula: C23H34O4
Molecular Weight: 374.52
Associated Items:
Names and Identifiers Canonical SMILES: C=C1O[C@]2(C)CC[C@H](C[C@@H]3O[C@@]3(C)CC/C=C(\C)CC[C@H]2OC(C)=O)C1=C
Standard InChI: InChI=1S/C23H34O4/c1-15-8-7-12-22(5)21(27-22)14-19-11-13-23(6,26-17(3)16(19)2)20(10-9-15)25-18(4)24/h8,19-21H,2-3,7,9-14H2,1,4-6H3/b15-8+/t19-,20-,21+,22+,23-/m1/s1
Standard InChI Key: GRGCZNZEROCQNE-HRGAUVHISA-N
Molfile:
RDKit 2D
29 31 0 0 0 0 0 0 0 0999 V2000
0.3359 0.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1609 0.5844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6221 -0.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1609 -0.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3359 -0.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2474 -1.4316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6163 -0.9125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1731 -1.2027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3041 -0.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9578 -0.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3199 0.2715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1440 0.9280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4464 0.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0765 1.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8178 1.7092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5452 1.5141 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9578 0.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7828 0.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9578 2.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3359 2.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1084 0.1761 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2552 -0.3431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0529 -0.8633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8689 -0.3431 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7828 -0.0604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5481 -1.6442 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0339 -2.2299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9909 -1.3505 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3995 -0.1313 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
1 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
3 17 1 0
17 18 2 0
16 19 2 0
14 20 1 1
13 21 1 6
21 22 1 0
22 23 1 0
22 24 2 0
10 25 1 0
6 26 1 0
5 26 1 0
6 27 1 6
5 28 1 1
3 29 1 6
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 374.52Molecular Weight (Monoisotopic): 374.2457AlogP: 5.24#Rotatable Bonds: 1Polar Surface Area: 48.06Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.12CX LogD: 4.12Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.36Np Likeness Score: 3.12
References 1. Ren X, Xie X, Chen B, Liu L, Jiang C, Qian Q.. (2021) Marine Natural Products: A Potential Source of Anti-hepatocellular Carcinoma Drugs., 64 (12.0): [PMID:34128674 ] [10.1021/acs.jmedchem.0c02026 ]