4-amino-6-methyl-7-phenylpyrrolo[2,1-c][1,2,4]triazine-3,8-dicarbonitrile

ID: ALA5285426

Max Phase: Preclinical

Molecular Formula: C15H10N6

Molecular Weight: 274.29

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(-c2ccccc2)c(C#N)c2nnc(C#N)c(N)n12

Standard InChI:  InChI=1S/C15H10N6/c1-9-13(10-5-3-2-4-6-10)11(7-16)15-20-19-12(8-17)14(18)21(9)15/h2-6H,18H2,1H3

Standard InChI Key:  RHIBZZAULAQUKQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 21 23  0  0  0  0  0  0  0  0999 V2000
    0.4364    0.1043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1510    0.5166    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8629    0.1047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8629   -0.7203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1528   -1.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4364   -0.7240    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3513    0.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3513   -0.9800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8383   -0.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5657    1.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7801    1.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6665   -0.3097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5657   -1.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1528   -1.9604    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0809   -1.0270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9067   -1.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3210   -0.3087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9102    0.4058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0825    0.4106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5802   -1.1345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2996   -1.5499    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  1  7  2  0
  6  8  1  0
  8  9  2  0
  9  7  1  0
  7 10  1  0
 10 11  3  0
  9 12  1  0
 13  8  1  0
  5 14  1  0
 15 12  2  0
 16 15  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 12 19  1  0
  4 20  1  0
 20 21  3  0
M  END

Alternative Forms

  1. Parent:

    ALA5285426

    ---

Associated Targets(Human)

OVCAR-4 (44535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 274.29Molecular Weight (Monoisotopic): 274.0967AlogP: 2.03#Rotatable Bonds: 1
Polar Surface Area: 103.79Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 0.98CX LogD: 0.98
Aromatic Rings: 3Heavy Atoms: 21QED Weighted: 0.73Np Likeness Score: -1.32

References

1. Cascioferro S, Parrino B, Spanò V, Carbone A, Montalbano A, Barraja P, Diana P, Cirrincione G..  (2017)  An overview on the recent developments of 1,2,4-triazine derivatives as anticancer compounds.,  142  [PMID:28851503] [10.1016/j.ejmech.2017.08.009]

Source