The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-acetamidothiazol-4-yl)-N-(2-(3-ethylureido)benzo[d]thiazol-6-yl)acetamide ID: ALA5285496
Max Phase: Preclinical
Molecular Formula: C17H18N6O3S2
Molecular Weight: 418.50
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)Nc1nc2ccc(NC(=O)Cc3csc(NC(C)=O)n3)cc2s1
Standard InChI: InChI=1S/C17H18N6O3S2/c1-3-18-15(26)23-17-22-12-5-4-10(6-13(12)28-17)20-14(25)7-11-8-27-16(21-11)19-9(2)24/h4-6,8H,3,7H2,1-2H3,(H,20,25)(H,19,21,24)(H2,18,22,23,26)
Standard InChI Key: OALQOPBHQOHIBI-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 30 0 0 0 0 0 0 0 0999 V2000
-0.2975 1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4170 1.4164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1289 1.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1289 0.1793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4188 -0.2323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2975 0.1756 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9136 -0.0755 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3986 0.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9137 1.2594 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 0.5919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6363 -0.1226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4614 -0.1226 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8741 -0.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6992 -0.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2238 -0.8372 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0120 1.4167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7266 1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4412 1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1558 1.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2421 0.1839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.0489 0.0123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4612 0.7267 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.9093 1.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4614 -0.7020 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2866 -0.7020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6992 -1.4167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6992 0.0123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7266 0.1790 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
8 7 2 0
3 9 1 0
9 8 1 0
8 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
11 15 2 0
1 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
20 19 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 19 2 0
21 24 1 0
24 25 1 0
25 26 1 0
25 27 2 0
17 28 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.50Molecular Weight (Monoisotopic): 418.0882AlogP: 3.03#Rotatable Bonds: 6Polar Surface Area: 125.11Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.59CX Basic pKa: ┄CX LogP: 2.32CX LogD: 2.09Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: -2.95