1-((2R,3aS,3a1R,4aR,4a1S,5aS,6S,8aS,8bS)-2-hydroxy-3a1,5a-dimethyl-3,3a,3a1,4a,4a1,5,5a,6,7,8,8a,8b,9,10-tetradecahydro-2H-cyclopenta[1,2]phenanthro[4,5-bcd]furan-6-yl)ethan-1-one

ID: ALA5285617

Max Phase: Preclinical

Molecular Formula: C21H30O3

Molecular Weight: 330.47

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=C[C@H](O)C[C@@H]5O[C@H](C[C@]12C)[C@@H]3[C@]45C

Standard InChI:  InChI=1S/C21H30O3/c1-11(22)15-6-7-16-14-5-4-12-8-13(23)9-18-21(12,3)19(14)17(24-18)10-20(15,16)2/h8,13-19,23H,4-7,9-10H2,1-3H3/t13-,14-,15+,16-,17+,18-,19+,20+,21+/m0/s1

Standard InChI Key:  NLCQTQAUAJGNLL-FDKYLEAMSA-N

Molfile:  

 
     RDKit          2D

 28 32  0  0  0  0  0  0  0  0999 V2000
   -2.3362   -0.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6218   -0.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9073   -0.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9073   -1.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6218   -2.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3362   -1.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1928   -0.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5216   -0.8153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5216   -1.6403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1928   -2.0528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1927    0.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5217    0.8346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2362    0.4222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2361   -0.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0402    0.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5109    0.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0189   -0.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0509   -2.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9073    0.0099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2506    0.5752    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1928   -1.2281    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.5216    0.0098    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3264   -1.2231    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3276    1.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2538    1.4694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6702    2.0529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0509    1.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1927    1.2474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  3  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  7 11  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  8 14  1  0
 13 15  1  0
 15 16  1  0
 17 16  1  0
 14 17  1  0
  6 18  1  6
  3 19  1  1
 11 20  1  0
  2 20  1  6
  7 21  1  6
  8 22  1  1
 14 23  1  6
 13 24  1  1
 15 25  1  1
 25 26  2  0
 25 27  1  0
 11 28  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5285617

    ---

Associated Targets(non-human)

Gabrp GABA-A receptor; anion channel (5731 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.47Molecular Weight (Monoisotopic): 330.2195AlogP: 3.50#Rotatable Bonds: 1
Polar Surface Area: 46.53Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.29CX LogD: 2.29
Aromatic Rings: Heavy Atoms: 24QED Weighted: 0.75Np Likeness Score: 2.95

References

1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG..  (2018)  Breakthroughs in neuroactive steroid drug discovery.,  28  (2): [PMID:29223589] [10.1016/j.bmcl.2017.11.043]

Source