The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
8-[1-[4-(1-naphthyl)phenyl]vinyl]-6,7,10-trioxaspiro[4.5]decane ID: ALA5285626
Max Phase: Preclinical
Molecular Formula: C25H24O3
Molecular Weight: 372.46
Associated Items:
Names and Identifiers Canonical SMILES: C=C(c1ccc(-c2cccc3ccccc23)cc1)C1COC2(CCCC2)OO1
Standard InChI: InChI=1S/C25H24O3/c1-18(24-17-26-25(28-27-24)15-4-5-16-25)19-11-13-21(14-12-19)23-10-6-8-20-7-2-3-9-22(20)23/h2-3,6-14,24H,1,4-5,15-17H2
Standard InChI Key: PMMXZHHWZXMSFZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 32 0 0 0 0 0 0 0 0999 V2000
2.9213 0.6165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2068 1.0290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4923 0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4923 -0.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2068 -0.6209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9213 -0.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7777 1.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0630 0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7777 1.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0627 -0.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6501 -0.6195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3651 -0.2067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3666 0.6144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6547 1.0309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6748 0.1269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2268 -0.4859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8144 -1.2003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0187 -0.9871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0793 -0.6191 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0795 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7920 -1.8544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5065 -1.4419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5081 -0.6212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7966 -0.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2218 -0.2140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2268 0.6103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5199 1.0261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8016 0.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
3 7 1 0
7 8 1 0
7 9 2 0
10 8 2 0
11 10 1 0
12 11 2 0
13 12 1 0
14 13 2 0
8 14 1 0
6 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
6 18 1 0
19 12 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
19 24 1 0
24 23 2 0
23 25 1 0
26 25 2 0
27 26 1 0
28 27 2 0
24 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 372.46Molecular Weight (Monoisotopic): 372.1725AlogP: 6.14#Rotatable Bonds: 3Polar Surface Area: 27.69Molecular Species: NEUTRALHBA: 3HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.43CX LogD: 6.43Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.52Np Likeness Score: 0.40
References 1. Patel OPS, Beteck RM, Legoabe LJ.. (2021) Exploration of artemisinin derivatives and synthetic peroxides in antimalarial drug discovery research., 213 [PMID:33508479 ] [10.1016/j.ejmech.2021.113193 ]