The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-butylcyclohexyl ((S)-4-methyl-1-oxo-1-(((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)pentan-2-yl)carbamate ID: ALA5285707
Max Phase: Preclinical
Molecular Formula: C24H41N3O5
Molecular Weight: 451.61
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC1CCC(OC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)C[C@@H]2CCNC2=O)CC1
Standard InChI: InChI=1S/C24H41N3O5/c1-4-5-6-17-7-9-20(10-8-17)32-24(31)27-21(13-16(2)3)23(30)26-19(15-28)14-18-11-12-25-22(18)29/h15-21H,4-14H2,1-3H3,(H,25,29)(H,26,30)(H,27,31)/t17?,18-,19-,20?,21-/m0/s1
Standard InChI Key: FOLCUFKJHSQMEL-BIXPGCQOSA-N
Molfile:
RDKit 2D
32 33 0 0 0 0 0 0 0 0999 V2000
2.2044 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4900 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4900 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7755 -0.0839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0610 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0610 -1.3214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6533 -0.0839 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3678 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3678 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0822 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7968 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7968 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0823 -0.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5112 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2257 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9402 -1.7339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6546 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2044 -0.0839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9189 -0.4964 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6338 -0.0836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3487 -0.4964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3487 -1.3209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6338 0.7418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3487 1.1546 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4349 1.9751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8512 2.5589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2421 2.1467 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6546 1.4322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1025 0.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2044 0.7411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.2044 -2.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9189 -1.3214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 6
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
9 8 1 0
10 9 1 0
11 10 1 0
12 11 1 0
13 12 1 0
8 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
18 3 1 0
19 18 1 0
20 19 1 1
20 21 1 0
21 22 2 0
20 23 1 0
24 23 1 1
25 24 1 0
25 26 2 0
25 27 1 0
27 28 1 0
28 29 1 0
24 29 1 0
18 30 2 0
1 31 1 0
1 32 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.61Molecular Weight (Monoisotopic): 451.3046AlogP: 3.09#Rotatable Bonds: 12Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.73CX Basic pKa: ┄CX LogP: 2.97CX LogD: 2.97Aromatic Rings: ┄Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: 0.66