4-butylcyclohexyl ((S)-4-methyl-1-oxo-1-(((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)pentan-2-yl)carbamate

ID: ALA5285707

Max Phase: Preclinical

Molecular Formula: C24H41N3O5

Molecular Weight: 451.61

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC1CCC(OC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)C[C@@H]2CCNC2=O)CC1

Standard InChI:  InChI=1S/C24H41N3O5/c1-4-5-6-17-7-9-20(10-8-17)32-24(31)27-21(13-16(2)3)23(30)26-19(15-28)14-18-11-12-25-22(18)29/h15-21H,4-14H2,1-3H3,(H,25,29)(H,26,30)(H,27,31)/t17?,18-,19-,20?,21-/m0/s1

Standard InChI Key:  FOLCUFKJHSQMEL-BIXPGCQOSA-N

Molfile:  

 
     RDKit          2D

 32 33  0  0  0  0  0  0  0  0999 V2000
    2.2044   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4900   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4900   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7755   -0.0839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0610   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0610   -1.3214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6533   -0.0839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3678   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3678   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0822   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7968   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7968   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0823   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5112   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2257   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9402   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6546   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2044   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9189   -0.4964    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6338   -0.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3487   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3487   -1.3209    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6338    0.7418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3487    1.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4349    1.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8512    2.5589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2421    2.1467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6546    1.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1025    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2044    0.7411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2044   -2.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9189   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  6
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
 11 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 18  3  1  0
 19 18  1  0
 20 19  1  1
 20 21  1  0
 21 22  2  0
 20 23  1  0
 24 23  1  1
 25 24  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 24 29  1  0
 18 30  2  0
  1 31  1  0
  1 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285707

    ---

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L929 (3802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 451.61Molecular Weight (Monoisotopic): 451.3046AlogP: 3.09#Rotatable Bonds: 12
Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.73CX Basic pKa: CX LogP: 2.97CX LogD: 2.97
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.39Np Likeness Score: 0.66

References

1. Gao K, Wang R, Chen J, Tepe JJ, Huang F, Wei GW..  (2021)  Perspectives on SARS-CoV-2 Main Protease Inhibitors.,  64  (23.0): [PMID:34798775] [10.1021/acs.jmedchem.1c00409]

Source