N-(4-bromophenyl)-2-(2,6-dioxo-5-phenyl-3,6-dihydropyrimidin-1(2H)-yl)acetamide

ID: ALA5285738

Max Phase: Preclinical

Molecular Formula: C18H14BrN3O3

Molecular Weight: 400.23

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cn1c(=O)[nH]cc(-c2ccccc2)c1=O)Nc1ccc(Br)cc1

Standard InChI:  InChI=1S/C18H14BrN3O3/c19-13-6-8-14(9-7-13)21-16(23)11-22-17(24)15(10-20-18(22)25)12-4-2-1-3-5-12/h1-10H,11H2,(H,20,25)(H,21,23)

Standard InChI Key:  PRAJYWRFOREGSM-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 27  0  0  0  0  0  0  0  0999 V2000
   -1.4278   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7133    0.2063    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0010   -0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0010   -1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7133   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4278   -1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7133    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0008    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0008    2.2683    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7152    1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4294    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4296    2.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1422    2.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8567    2.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8582    1.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1468    1.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5710    2.6788    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    0.7154    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1422    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1422   -1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1424   -2.2684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8549   -2.6788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5694   -2.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5710   -1.4456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8595   -1.0294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 14 17  1  0
  3 18  2  0
  1 19  2  0
 20  6  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 20 25  1  0
 25 24  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5285738

    ---

Associated Targets(Human)

FPR2 Tchem Lipoxin A4 receptor (3472 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
FPR1 Tchem Formyl peptide receptor 1 (1372 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 400.23Molecular Weight (Monoisotopic): 399.0219AlogP: 2.60#Rotatable Bonds: 4
Polar Surface Area: 83.96Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.17CX Basic pKa: CX LogP: 2.72CX LogD: 2.72
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.71Np Likeness Score: -1.40

References

1. Maciuszek M, Cacace A, Brennan E, Godson C, Chapman TM..  (2021)  Recent advances in the design and development of formyl peptide receptor 2 (FPR2/ALX) agonists as pro-resolving agents with diverse therapeutic potential.,  213  [PMID:33486199] [10.1016/j.ejmech.2021.113167]

Source