The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Bromovulone III ID: ALA5285742
Max Phase: Preclinical
Molecular Formula: C21H29BrO4
Molecular Weight: 425.36
Associated Items:
Names and Identifiers Canonical SMILES: CCCCC/C=C\CC1(O)C=C(Br)C(=O)/C1=C\C=C\CCCC(=O)OC
Standard InChI: InChI=1S/C21H29BrO4/c1-3-4-5-6-9-12-15-21(25)16-18(22)20(24)17(21)13-10-7-8-11-14-19(23)26-2/h7,9-10,12-13,16,25H,3-6,8,11,14-15H2,1-2H3/b10-7+,12-9-,17-13+
Standard InChI Key: SEUGRXZAXYVQIH-QVOMYVINSA-N
Molfile:
RDKit 2D
26 26 0 0 0 0 0 0 0 0999 V2000
0.5189 -3.4043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0376 -2.9399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8345 -3.1535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4178 -2.5701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2043 -1.7733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7876 -1.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5741 -0.3930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2120 0.0930 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8372 -0.3720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6180 -1.1899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6340 -0.1584 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.2120 0.9180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7772 -0.1795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5637 0.6173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2330 0.8308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4466 1.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2434 1.8412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4570 2.6381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2538 2.8516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4673 3.6484 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8371 2.2683 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6340 2.4817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0012 -1.9868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2933 -3.1199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9268 -3.6484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7012 -3.3641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 1 0
6 7 1 0
7 8 1 0
9 8 1 0
10 9 2 0
6 10 1 0
9 11 1 0
8 12 2 0
7 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 2 0
19 21 1 0
21 22 1 0
6 23 1 0
1 24 1 0
24 25 1 0
25 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.36Molecular Weight (Monoisotopic): 424.1249AlogP: 4.93#Rotatable Bonds: 11Polar Surface Area: 63.60Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.42CX Basic pKa: ┄CX LogP: 5.15CX LogD: 5.15Aromatic Rings: ┄Heavy Atoms: 26QED Weighted: 0.22Np Likeness Score: 2.14
References 1. Ren X, Xie X, Chen B, Liu L, Jiang C, Qian Q.. (2021) Marine Natural Products: A Potential Source of Anti-hepatocellular Carcinoma Drugs., 64 (12.0): [PMID:34128674 ] [10.1021/acs.jmedchem.0c02026 ]