1-(4-(6-(3,5-Dimethylisoxazol-4-yl)-5-methyl-2-(3-(((2-(methylamino)ethyl)amino)methyl)phenyl)pyrimidin-4-yl)piperazin-1-yl)ethanone

ID: ALA5285757

Max Phase: Preclinical

Molecular Formula: C26H35N7O2

Molecular Weight: 477.61

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNCCNCc1cccc(-c2nc(-c3c(C)noc3C)c(C)c(N3CCN(C(C)=O)CC3)n2)c1

Standard InChI:  InChI=1S/C26H35N7O2/c1-17-24(23-18(2)31-35-19(23)3)29-25(22-8-6-7-21(15-22)16-28-10-9-27-5)30-26(17)33-13-11-32(12-14-33)20(4)34/h6-8,15,27-28H,9-14,16H2,1-5H3

Standard InChI Key:  SVBLRLWYPNYOPQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   36.7385  -18.3809    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.9201  -22.4984    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.9189  -23.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6317  -23.7351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3462  -23.3230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.3432  -22.4948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   34.6299  -22.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.2075  -22.0872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   32.4952  -22.4987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.0542  -22.0807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7654  -22.4925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4759  -22.0791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4731  -21.2555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7541  -20.8471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0467  -21.2628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.1836  -20.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   38.1872  -22.4859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.7826  -22.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.0703  -22.4991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   30.3577  -22.0880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.2758  -23.2975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.0780  -23.4646    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   39.4848  -22.7533    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   38.9340  -22.1466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1003  -21.3410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.6666  -23.8505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.6454  -22.4994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7482  -20.0244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   37.4579  -19.6116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4540  -18.7926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0291  -18.7979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0314  -19.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7347  -17.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.4452  -17.1436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.0204  -17.1501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  2  8  1  0
  8  9  1  0
  6 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 10  1  0
 13 16  1  0
 12 17  1  0
  9 18  1  0
 18 19  1  0
 19 20  1  0
 17 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 17  1  0
 24 25  1  0
 21 26  1  0
 20 27  1  0
 14 28  1  0
 28 29  1  0
 28 32  1  0
 29 30  1  0
 30  1  1  0
  1 31  1  0
 31 32  1  0
  1 33  1  0
 33 34  1  0
 33 35  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5285757

    ---

Associated Targets(Human)

CARM1 Tchem Histone-arginine methyltransferase CARM1 (564 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.61Molecular Weight (Monoisotopic): 477.2852AlogP: 2.70#Rotatable Bonds: 8
Polar Surface Area: 99.42Molecular Species: BASEHBA: 8HBD: 2
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.60CX LogP: 2.85CX LogD: 0.65
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -1.29

References

1. Zhang Z, Guo Z, Xu X, Cao D, Yang H, Li Y, Shi Q, Du Z, Guo X, Wang X, Chen D, Zhang Y, Chen L, Zhou K, Li J, Geng M, Huang X, Xiong B..  (2021)  Structure-Based Discovery of Potent CARM1 Inhibitors for Solid Tumor and Cancer Immunology Therapy.,  64  (22.0): [PMID:34781683] [10.1021/acs.jmedchem.1c01308]

Source