5-methoxy-N-(3-methoxy-4-(2-(pyridin-3-yl)ethoxy)phenyl)-2,2-dimethyl-2H-chromene-6-carboxamide

ID: ALA5285767

Max Phase: Preclinical

Molecular Formula: C27H28N2O5

Molecular Weight: 460.53

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(NC(=O)c2ccc3c(c2OC)C=CC(C)(C)O3)ccc1OCCc1cccnc1

Standard InChI:  InChI=1S/C27H28N2O5/c1-27(2)13-11-20-22(34-27)10-8-21(25(20)32-4)26(30)29-19-7-9-23(24(16-19)31-3)33-15-12-18-6-5-14-28-17-18/h5-11,13-14,16-17H,12,15H2,1-4H3,(H,29,30)

Standard InChI Key:  DFESPPMXMPVLSH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
    0.6609    2.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3755    3.1496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0874    2.7377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0874    1.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3773    1.5007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6609    1.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0536    1.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0536    0.6710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7682    1.9088    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4829    1.4962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4832    0.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1960    0.2603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9109    0.6730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9124    1.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2006    1.9106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6271    1.9067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3417    1.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6254    0.2604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6254   -0.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9109   -0.9773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9109   -1.8025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1963   -2.2153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1970   -3.0380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9119   -3.4507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6238   -3.0416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6285   -2.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3773    0.6755    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0919    0.2629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8052    1.4983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5168    1.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5150    2.7361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8001    3.1486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417    2.7361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9276    3.4507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 14 16  1  0
 16 17  1  0
 13 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 21 26  1  0
  5 27  1  0
 27 28  1  0
  4 29  1  0
 29 30  2  0
 30 31  1  0
 31 32  1  0
  3 32  1  0
 31 33  1  0
 31 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285767

    ---

Associated Targets(Human)

NCI-H1299 (3248 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.53Molecular Weight (Monoisotopic): 460.1998AlogP: 5.16#Rotatable Bonds: 8
Polar Surface Area: 78.91Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 5.45CX LogP: 4.29CX LogD: 4.28
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.50Np Likeness Score: 0.11

References

1. Amatya E, Blagg BSJ..  (2023)  Recent advances toward the development of Hsp90 C-terminal inhibitors.,  80  [PMID:36549397] [10.1016/j.bmcl.2022.129111]

Source