(S)-isobutyl 4-(2-(4-(aminomethyl)cyclohexanecarboxamido)-5-guanidinopentanamido)benzoate

ID: ALA5285825

Max Phase: Preclinical

Molecular Formula: C25H40N6O4

Molecular Weight: 488.63

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)COC(=O)c1ccc(NC(=O)[C@H](CCCNC(=N)N)NC(=O)C2CCC(CN)CC2)cc1

Standard InChI:  InChI=1S/C25H40N6O4/c1-16(2)15-35-24(34)19-9-11-20(12-10-19)30-23(33)21(4-3-13-29-25(27)28)31-22(32)18-7-5-17(14-26)6-8-18/h9-12,16-18,21H,3-8,13-15,26H2,1-2H3,(H,30,33)(H,31,32)(H4,27,28,29)/t17?,18-,21-/m0/s1

Standard InChI Key:  VCJXXPCXYYSRHF-VLQCZPCNSA-N

Molfile:  

 
     RDKit          2D

 35 36  0  0  0  0  0  0  0  0999 V2000
   -2.4992    1.8560    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847    1.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847    0.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0702    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0702   -0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847   -1.0314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4992   -0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4992    0.2060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9281   -0.6189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6425   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6425   -1.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3570   -2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0715   -1.8564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9281   -2.2689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136   -1.8564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558   -1.8564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3586   -0.6189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0730   -1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0730   -1.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7893   -2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991   -1.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136   -2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136   -3.0935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9281   -1.8560    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6425   -2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3570   -1.8560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0715   -2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3570   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4991   -1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7875   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4992    2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136    3.0935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7847    3.0935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  1
  5  6  1  0
  6  7  1  0
  7  8  2  0
  9  7  1  6
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 16  9  1  0
 17  5  1  0
 17 18  2  0
 19 17  1  0
 20 19  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  2  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 28 30  1  0
 23 31  2  0
 31 32  1  0
 32 20  2  0
  1 33  1  0
 33 34  2  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285825

    ---

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PLG Tclin Plasminogen (2339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.63Molecular Weight (Monoisotopic): 488.3111AlogP: 1.95#Rotatable Bonds: 12
Polar Surface Area: 172.42Molecular Species: BASEHBA: 6HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 8#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.39CX Basic pKa: 11.78CX LogP: 1.57CX LogD: -3.08
Aromatic Rings: 1Heavy Atoms: 35QED Weighted: 0.11Np Likeness Score: -0.59

References

1. Xie Z, Li Z, Shao Y, Liao C..  (2020)  Discovery and development of plasma kallikrein inhibitors for multiple diseases.,  190  [PMID:32066009] [10.1016/j.ejmech.2020.112137]

Source