(S)-2-decyl-N4-hydroxy-N1-((S)-2-(methylamino)-2-oxo-1-phenylethyl)succinamide

ID: ALA5285908

Max Phase: Preclinical

Molecular Formula: C23H37N3O4

Molecular Weight: 419.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCCCC[C@@H](CC(=O)NO)C(=O)N[C@H](C(=O)NC)c1ccccc1

Standard InChI:  InChI=1S/C23H37N3O4/c1-3-4-5-6-7-8-9-11-16-19(17-20(27)26-30)22(28)25-21(23(29)24-2)18-14-12-10-13-15-18/h10,12-15,19,21,30H,3-9,11,16-17H2,1-2H3,(H,24,29)(H,25,28)(H,26,27)/t19-,21-/m0/s1

Standard InChI Key:  XAGGTRYSDSBYRX-FPOVZHCZSA-N

Molfile:  

 
     RDKit          2D

 30 30  0  0  0  0  0  0  0  0999 V2000
    1.0674    0.4111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0674   -0.4138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7808   -0.8202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4878   -0.4101    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4878    0.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7790    0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7790    1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0673    2.0542    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3558    1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674    1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674    0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7790    0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7790   -0.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4906   -0.8216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4906   -1.6434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2022   -2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2022   -2.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9138   -3.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9138   -4.1084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3558    2.8759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674    3.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674    4.1084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7790    2.8759    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4906    3.2868    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3558    0.8216    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4906    2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4906    2.8759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2022    1.6434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9138    2.0542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  7  6  1  6
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 10 21  1  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
  9 26  2  0
  7 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285908

    ---

Associated Targets(Human)

MMP9 Tchem Matrix metalloproteinase 9 (6779 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MMP2 Tchem Matrix metalloproteinase-2 (6627 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2784AlogP: 3.63#Rotatable Bonds: 15
Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 4HBD: 4
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski):
CX Acidic pKa: 8.90CX Basic pKa: CX LogP: 3.58CX LogD: 3.57
Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.20Np Likeness Score: -0.01

References

1. Mondal S, Adhikari N, Banerjee S, Amin SA, Jha T..  (2020)  Matrix metalloproteinase-9 (MMP-9) and its inhibitors in cancer: A minireview.,  194  [PMID:32224379] [10.1016/j.ejmech.2020.112260]

Source