The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-decyl-N4-hydroxy-N1-((S)-2-(methylamino)-2-oxo-1-phenylethyl)succinamide ID: ALA5285908
Max Phase: Preclinical
Molecular Formula: C23H37N3O4
Molecular Weight: 419.57
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCC[C@@H](CC(=O)NO)C(=O)N[C@H](C(=O)NC)c1ccccc1
Standard InChI: InChI=1S/C23H37N3O4/c1-3-4-5-6-7-8-9-11-16-19(17-20(27)26-30)22(28)25-21(23(29)24-2)18-14-12-10-13-15-18/h10,12-15,19,21,30H,3-9,11,16-17H2,1-2H3,(H,24,29)(H,25,28)(H,26,27)/t19-,21-/m0/s1
Standard InChI Key: XAGGTRYSDSBYRX-FPOVZHCZSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
1.0674 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0674 -0.4138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7808 -0.8202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4878 -0.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4878 0.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7790 0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7790 1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0673 2.0542 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3558 2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0674 1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0674 0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7790 0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7790 -0.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4906 -0.8216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4906 -1.6434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2022 -2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2022 -2.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 -3.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 -4.1084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3558 2.8759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0674 3.2868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0674 4.1084 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7790 2.8759 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.4906 3.2868 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3558 0.8216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4906 2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4906 2.8759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2022 1.6434 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9138 2.0542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
7 6 1 6
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 1
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
10 21 1 0
21 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
9 26 2 0
7 27 1 0
27 28 2 0
27 29 1 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 419.57Molecular Weight (Monoisotopic): 419.2784AlogP: 3.63#Rotatable Bonds: 15Polar Surface Area: 107.53Molecular Species: NEUTRALHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.90CX Basic pKa: ┄CX LogP: 3.58CX LogD: 3.57Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.20Np Likeness Score: -0.01
References 1. Mondal S, Adhikari N, Banerjee S, Amin SA, Jha T.. (2020) Matrix metalloproteinase-9 (MMP-9) and its inhibitors in cancer: A minireview., 194 [PMID:32224379 ] [10.1016/j.ejmech.2020.112260 ]