ID: ALA5285918

Max Phase: Preclinical

Molecular Formula: C14H10N4O2S2

Molecular Weight: 330.39

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCSc1nn2c(=N)c3c(=O)oc4ccccc4c3nc2s1

Standard InChI:  InChI=1S/C14H10N4O2S2/c1-2-21-14-17-18-11(15)9-10(16-13(18)22-14)7-5-3-4-6-8(7)20-12(9)19/h3-6,15H,2H2,1H3

Standard InChI Key:  GPIAELGJRSOOGO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 22 25  0  0  0  0  0  0  0  0999 V2000
   -2.1425   -1.7298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4279   -1.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7160   -1.7294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7160   -2.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4261   -2.9664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1425   -2.5583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -1.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -1.7295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -2.5546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -2.9672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4278   -2.9672    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0013   -0.4916    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -0.0790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4279   -0.4917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4279   -1.3168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8987    0.7424    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7002    0.8233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0323    0.0634    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1128    1.5379    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7002    2.2525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1128    2.9672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1425   -1.7295    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
  9 11  2  0
  7 12  1  0
 13 12  2  0
 14 13  1  0
 15 14  1  0
  8 15  1  0
 13 16  1  0
 16 17  1  0
 18 17  2  0
 14 18  1  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 15 22  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5285918

    ---

Associated Targets(non-human)

Aspergillus niger (16508 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 330.39Molecular Weight (Monoisotopic): 330.0245AlogP: 2.64#Rotatable Bonds: 2
Polar Surface Area: 84.25Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 2.94CX LogD: 2.94
Aromatic Rings: 4Heavy Atoms: 22QED Weighted: 0.35Np Likeness Score: -1.38

References

1. Salehian F, Nadri H, Jalili-Baleh L, Youseftabar-Miri L, Abbas Bukhari SN, Foroumadi A, Tüylü Küçükkilinç T, Sharifzadeh M, Khoobi M..  (2021)  A review: Biologically active 3,4-heterocycle-fused coumarins.,  212  [PMID:33276991] [10.1016/j.ejmech.2020.113034]

Source