The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(9-(4-benzylpiperazin-1-yl)-6-oxaspiro[4.5]decan-9-yl)(phenyl)methanone ID: ALA5285937
Max Phase: Preclinical
Molecular Formula: C27H34N2O2
Molecular Weight: 418.58
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccccc1)C1(N2CCN(Cc3ccccc3)CC2)CCOC2(CCCC2)C1
Standard InChI: InChI=1S/C27H34N2O2/c30-25(24-11-5-2-6-12-24)27(15-20-31-26(22-27)13-7-8-14-26)29-18-16-28(17-19-29)21-23-9-3-1-4-10-23/h1-6,9-12H,7-8,13-22H2
Standard InChI Key: KOTAUKMMTMZZBN-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 35 0 0 0 0 0 0 0 0999 V2000
-1.7842 2.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0697 2.5546 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 2.1421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 1.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0697 0.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7842 1.3170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3555 -0.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3555 0.4922 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3586 0.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0728 0.4923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0728 -0.3324 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3586 -0.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7840 0.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4982 0.9046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7840 -0.3324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0698 -0.7450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0706 -1.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7850 -1.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4965 -1.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5013 -0.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7871 -0.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7871 -1.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5013 -1.9821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5005 -2.8043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7860 -3.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0745 -2.8079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0698 -1.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3553 2.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4483 3.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9188 2.5635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4361 1.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 1 0
1 6 1 0
6 5 1 0
8 7 1 0
8 5 1 0
8 9 1 0
10 9 1 0
11 10 1 0
12 11 1 0
7 12 1 0
13 5 1 0
13 14 2 0
13 15 1 0
16 15 2 0
17 16 1 0
18 17 2 0
19 18 1 0
20 19 2 0
15 20 1 0
11 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
3 28 1 0
28 29 1 0
29 30 1 0
31 30 1 0
3 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.58Molecular Weight (Monoisotopic): 418.2620AlogP: 4.55#Rotatable Bonds: 5Polar Surface Area: 32.78Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.08CX LogP: 4.46CX LogD: 4.29Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -0.32
References 1. Zhuang T, Xiong J, Hao S, Du W, Liu Z, Liu B, Zhang G, Chen Y.. (2021) Bifunctional μ opioid and σ1 receptor ligands as novel analgesics with reduced side effects., 223 [PMID:34175542 ] [10.1016/j.ejmech.2021.113658 ]