17-bromooscillatoxin B2

ID: ALA5285959

Max Phase: Preclinical

Molecular Formula: C32H45BrO10

Molecular Weight: 669.61

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H](CC[C@H](C)[C@H]1O[C@@]23C[C@H](OC(=O)C[C@H]([C@@H](C)O)OC(=O)/C=C(\O2)[C@@](C)(O)CC3(C)C)[C@@H]1C)c1cc(O)ccc1Br

Standard InChI:  InChI=1S/C32H45BrO10/c1-17(8-11-23(39-7)21-12-20(35)9-10-22(21)33)29-18(2)25-15-32(43-29)30(4,5)16-31(6,38)26(42-32)14-28(37)40-24(19(3)34)13-27(36)41-25/h9-10,12,14,17-19,23-25,29,34-35,38H,8,11,13,15-16H2,1-7H3/b26-14-/t17-,18-,19+,23-,24+,25-,29+,31-,32+/m0/s1

Standard InChI Key:  YDMZOYPZIGUJJL-KASRWXAJSA-N

Molfile:  

 
     RDKit          2D

 45 48  0  0  0  0  0  0  0  0999 V2000
   -1.4273   -0.9768    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273   -0.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128   -0.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7128   -1.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0016   -0.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7161   -0.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7161   -1.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4305   -0.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1451   -0.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8595   -0.1518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8595    0.6732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1451    1.0857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5740   -0.5642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5740   -1.3928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2905   -1.8009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2905   -2.6259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0006   -1.3891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0006   -0.5639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2887   -0.1519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2887    0.6730    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -0.3258    0.7169    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1419    1.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4273    0.6734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8567    0.6734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5713    1.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2861    0.6735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2861   -0.1517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0006   -0.5642    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5714   -0.5644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5714   -1.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3579   -2.1865    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2859   -1.8022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2859   -2.6272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0004   -1.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8567   -1.8023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -1.3897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4275   -1.8022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -0.5644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5713    1.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8567    2.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1419    1.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7295    2.6258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3154    1.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9846    2.6272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3963    1.9114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  2  3  1  0
  3  4  1  1
  3  5  1  0
  5  6  1  0
  6  7  1  6
  6  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  6
 11 12  1  0
 10 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 15 17  1  0
 17 18  2  0
 18 19  1  0
 19 13  2  0
 19 20  1  0
  5 21  1  6
 22 21  1  0
 22 23  1  6
  2 23  1  0
 24 22  1  0
 25 24  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 27 29  1  0
 29 30  1  0
 30 31  1  1
 30 32  1  0
 32 33  1  6
 32 34  1  0
 30 35  1  0
 35 36  1  0
 36 37  2  0
 36 38  1  0
  2 38  1  0
 39 25  1  0
 39 40  1  0
 41 40  1  0
 22 41  1  0
 41 42  1  0
 41 43  1  0
 39 44  1  1
 39 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285959

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Nitzschia amabilis (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 669.61Molecular Weight (Monoisotopic): 668.2196AlogP: 5.07#Rotatable Bonds: 7
Polar Surface Area: 140.98Molecular Species: NEUTRALHBA: 10HBD: 3
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.92CX Basic pKa: CX LogP: 5.28CX LogD: 5.27
Aromatic Rings: 1Heavy Atoms: 43QED Weighted: 0.34Np Likeness Score: 1.76

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source