(2S,4R)-1-((S)-2-acetamido-3,3-dimethylbutanoyl)-4-hydroxy-N-((S)-3-(methylamino)-1-(4-(4-methylthiazol-5-yl)phenyl)-3-oxopropyl)pyrrolidine-2-carboxamide

ID: ALA5285978

Max Phase: Preclinical

Molecular Formula: C27H37N5O5S

Molecular Weight: 543.69

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CNC(=O)C[C@H](NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)[C@@H](NC(C)=O)C(C)(C)C)c1ccc(-c2scnc2C)cc1

Standard InChI:  InChI=1S/C27H37N5O5S/c1-15-23(38-14-29-15)18-9-7-17(8-10-18)20(12-22(35)28-6)31-25(36)21-11-19(34)13-32(21)26(37)24(27(3,4)5)30-16(2)33/h7-10,14,19-21,24,34H,11-13H2,1-6H3,(H,28,35)(H,30,33)(H,31,36)/t19-,20+,21+,24-/m1/s1

Standard InChI Key:  DHJHMRSRAVXNPQ-MDAIXWLXSA-N

Molfile:  

 
     RDKit          2D

 38 40  0  0  0  0  0  0  0  0999 V2000
    5.2526  -16.5164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2515  -17.3437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9663  -17.7566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6828  -17.3433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6798  -16.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9645  -16.1036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9620  -15.2786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6753  -14.8640    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.3909  -15.2743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1042  -14.8597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3934  -16.0993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8594  -15.1914    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4096  -14.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9949  -13.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1886  -14.0374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3282  -13.1086    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0342  -15.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4234  -16.5521    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8198  -16.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9947  -17.0556    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.4307  -15.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2163  -15.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2558  -14.8885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0124  -15.1039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7803  -17.3074    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9551  -18.1136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3911  -16.7528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.9711  -18.5816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3036  -19.0663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5583  -19.8510    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3834  -19.8512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6384  -19.0667    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.5191  -18.8112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2464  -14.8683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2439  -14.0433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5282  -13.6329    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.9571  -13.6287    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5258  -12.8079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
 10  9  1  6
  9 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 10  1  0
 14 16  1  1
 12 17  1  0
 17 18  2  0
 17 19  1  0
 19 20  1  6
 19 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
 20 25  1  0
 25 26  1  0
 25 27  2  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 28  1  0
  3 28  1  0
 29 33  1  0
  7 34  1  6
 34 35  1  0
 35 36  1  0
 35 37  2  0
 36 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5285978

    ---

Associated Targets(Human)

VHL Tchem Von Hippel-Lindau disease tumor suppressor (136 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 543.69Molecular Weight (Monoisotopic): 543.2515AlogP: 1.92#Rotatable Bonds: 8
Polar Surface Area: 140.73Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.41CX Basic pKa: 2.65CX LogP: -0.14CX LogD: -0.14
Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.40Np Likeness Score: -0.47

References

1. Han X, Wang C, Qin C, Xiang W, Fernandez-Salas E, Yang CY, Wang M, Zhao L, Xu T, Chinnaswamy K, Delproposto J, Stuckey J, Wang S..  (2019)  Discovery of ARD-69 as a Highly Potent Proteolysis Targeting Chimera (PROTAC) Degrader of Androgen Receptor (AR) for the Treatment of Prostate Cancer.,  62  (2): [PMID:30629437] [10.1021/acs.jmedchem.8b01631]

Source