2-((2S,3S,4R)-1-(4-(((3R,4R)-1-(5-chloro-2-methoxypyridin-4-yl)-3-methylpiperidin-4-yl)oxy)phenyl)-4-(3-methoxypropoxy)-3-methylpyrrolidin-2-yl)acetic acid

ID: ALA5285988

Max Phase: Preclinical

Molecular Formula: C29H40ClN3O6

Molecular Weight: 562.11

Names and Identifiers

Canonical SMILES:  COCCCO[C@H]1CN(c2ccc(O[C@@H]3CCN(c4cc(OC)ncc4Cl)C[C@H]3C)cc2)[C@@H](CC(=O)O)[C@@H]1C

Standard InChI:  InChI=1S/C29H40ClN3O6/c1-19-17-32(25-14-28(37-4)31-16-23(25)30)11-10-26(19)39-22-8-6-21(7-9-22)33-18-27(38-13-5-12-36-3)20(2)24(33)15-29(34)35/h6-9,14,16,19-20,24,26-27H,5,10-13,15,17-18H2,1-4H3,(H,34,35)/t19-,20+,24+,26-,27+/m1/s1

Standard InChI Key:  CEBGUURUAFCIGS-UAVGYUILSA-N

Molfile:  

 
     RDKit          2D

 39 42  0  0  0  0  0  0  0  0999 V2000
   -1.0790    1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3644    1.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3474    1.3920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3474    0.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3626    0.1550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0790    0.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0621    0.1543    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8155    0.4898    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3675   -0.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9551   -0.8374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1482   -0.6659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5651   -1.2490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7786   -2.0456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1954   -2.6286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5751   -2.2590    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1921   -0.1231    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6045    0.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4292    0.5910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8415    1.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6662    1.3052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0785    2.0194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7931    1.8040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5073    1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5073    0.5669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2214    0.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9357    0.5669    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9357    1.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2214    1.8040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2214    2.6286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6499    0.1547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6502   -0.6699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3625   -1.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0770   -0.6679    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0785    0.1526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3671    0.5688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3671    1.3934    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.3625   -1.9051    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6483   -2.3174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3674   -1.5516    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  7  4  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11  7  1  0
 11 12  1  6
 12 13  1  0
 13 14  1  0
 13 15  2  0
  9 16  1  6
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
  1 22  1  0
 23 22  1  6
 24 23  1  0
 25 24  1  0
 26 25  1  0
 27 26  1  0
 28 27  1  0
 23 28  1  0
 28 29  1  1
 30 26  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 30 35  1  0
 35 36  1  0
 32 37  1  0
 37 38  1  0
 10 39  1  1
M  END

Alternative Forms

1. Parent:

   

   ALA5285988

   ---

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type:

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 562.11

Molecular Weight (Monoisotopic): 561.2606

AlogP: 4.76

#Rotatable Bonds: 12

Polar Surface Area: 93.59

Molecular Species: ACID

HBA: 8

HBD: 1

#RO5 Violations: 1

HBA (Lipinski): 9

HBD (Lipinski): 1

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 3.39

CX Basic pKa: 5.78

CX LogP: 2.90

CX LogD: 1.45

Aromatic Rings: 2

Heavy Atoms: 39

QED Weighted: 0.37

Np Likeness Score: -0.35

References

1. Jurica EA, Wu X, Williams KN, Haque LE, Rampulla RA, Mathur A, Zhou M, Cao G, Cai H, Wang T, Liu H, Xu C, Kunselman LK, Antrilli TM, Hicks MB, Sun Q, Dierks EA, Apedo A, Moore DB, Foster KA, Cvijic ME, Panemangalore R, Khandelwal P, Wilkes JJ, Zinker BA, Robertson DG, Janovitz EB, Galella M, Li YX, Li J, Ramar T, Jalagam PR, Jayaram R, Whaley JM, Barrish JC, Robl JA, Ewing WR, Ellsworth BA..  (2023)  Optimization of physicochemical properties of pyrrolidine GPR40 AgoPAMs results in a differentiated profile with improved pharmacokinetics and reduced off-target activities.,  85  [PMID:37030194] [10.1016/j.bmc.2023.117273]

Source

Source(1):

• Scientific Literature