2-(2-(4-carboxybutyl)phenyl)-1-(2-(6-carboxyhexyl)phenyl)diazene 1-oxide

ID: ALA5286024

Max Phase: Preclinical

Molecular Formula: C24H30N2O5

Molecular Weight: 426.51

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(O)CCCCCCc1ccccc1/[N+]([O-])=N/c1ccccc1CCCCC(=O)O

Standard InChI:  InChI=1S/C24H30N2O5/c27-23(28)17-4-2-1-3-13-20-14-6-9-16-22(20)26(31)25-21-15-8-5-11-19(21)12-7-10-18-24(29)30/h5-6,8-9,11,14-16H,1-4,7,10,12-13,17-18H2,(H,27,28)(H,29,30)/b26-25-

Standard InChI Key:  PVDHNLOAHKSAFS-QPLCGJKRSA-N

Molfile:  

 
     RDKit          2D

 31 32  0  0  0  0  0  0  0  0999 V2000
   -3.5717    2.2677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8571    2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1453    2.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1453    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8553    1.0311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5717    1.4392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8553    0.2059    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1407   -0.2066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1407   -1.0318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5700   -0.2066    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4262   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4269   -2.2673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1418   -2.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8537   -2.2708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8584   -1.4461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4306    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7160    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0014    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4278    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1424    1.4429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7115   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0030   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7176   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4323   -1.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1469   -1.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5717    1.4429    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571    0.2052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8615   -1.4446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1469   -0.2068    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  5  7  1  0
  7  8  2  0
  8  9  1  0
  7 10  1  0
 11  9  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
  9 15  1  0
  4 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 11 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 27  1  0
 27 28  1  0
 27 29  2  0
 26 30  1  0
 26 31  2  0
M  CHG  2   7   1  10  -1
M  END

Alternative Forms

  1. Parent:

    ALA5286024

    ---

Associated Targets(non-human)

Epidermophyton floccosum (561 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.51Molecular Weight (Monoisotopic): 426.2155AlogP: 5.99#Rotatable Bonds: 14
Polar Surface Area: 113.03Molecular Species: ACIDHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.46CX Basic pKa: CX LogP: 4.57CX LogD: 0.13
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.17Np Likeness Score: -0.13

References

1. He X, Peng G, Luo J, Huang JP, Yang J, Yan Y, Gu YC, Wang L, Huang SX..  (2023)  O-Alkylazoxymycins A-F, Naturally Occurring Azoxy-Aromatic Compounds from Streptomyces sp. Py50.,  86  (1.0): [PMID:36634313] [10.1021/acs.jnatprod.2c00892]

Source