22S,25-Epoxylanosta-7,9(11)-dien-3beta,24S-diol

ID: ALA5286041

Max Phase: Preclinical

Molecular Formula: C30H48O3

Molecular Weight: 456.71

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H]([C@@H]1C[C@H](O)C(C)(C)O1)[C@H]1CC[C@@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)C3=CC[C@]12C

Standard InChI:  InChI=1S/C30H48O3/c1-18(22-17-25(32)27(4,5)33-22)19-11-15-30(8)21-9-10-23-26(2,3)24(31)13-14-28(23,6)20(21)12-16-29(19,30)7/h9,12,18-19,22-25,31-32H,10-11,13-17H2,1-8H3/t18-,19+,22-,23-,24-,25-,28+,29+,30-/m0/s1

Standard InChI Key:  ZSJNLSFWYLWTHK-TUWHUXBLSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -3.3913   -1.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6769   -0.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9625   -1.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9625   -1.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6769   -2.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3913   -1.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2480   -0.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5335   -1.0366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5335   -1.8615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2480   -2.2741    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2480    0.2008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5335    0.6132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1808    0.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1808   -0.6241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9653   -0.8791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9654    0.4556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4503   -0.2118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1790    1.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5955    1.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9761    1.4663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2716    2.2363    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.0954    2.1932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3088    1.3964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6171    0.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1059   -2.2741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9625   -0.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1808    1.0260    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9625   -2.6867    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1808   -1.4493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1059    1.1828    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8939    2.4071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3099    2.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7768    0.6060    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0903   -2.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2651   -2.9900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3926    2.0498    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  3  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
  7 11  2  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
  8 14  1  0
 14 15  1  0
 13 16  1  0
 16 17  1  0
 17 15  1  0
 16 18  1  0
 18 19  1  6
 18 20  1  0
 21 20  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 20  1  0
  6 25  1  1
  3 26  1  1
 13 27  1  1
  4 28  1  6
 14 29  1  6
 23 30  1  1
 22 31  1  0
 22 32  1  0
 16 33  1  6
  5 34  1  0
  5 35  1  0
 20 36  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5286041

    ---

Associated Targets(non-human)

H9c2 (3506 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.71Molecular Weight (Monoisotopic): 456.3603AlogP: 6.44#Rotatable Bonds: 2
Polar Surface Area: 49.69Molecular Species: NEUTRALHBA: 3HBD: 2
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.93CX Basic pKa: CX LogP: 4.98CX LogD: 4.98
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.50Np Likeness Score: 3.31

References

1. Han Y, Cheng Y, Tian LW..  (2023)  Semisynthesis of 22,25-Epoxylanostane Triterpenoids: Structure Revision and Protective Effects against Oxygen-Glucose Deprivation/Reoxygenation Injury in H9c2 Cells.,  86  (2.0): [PMID:36748235] [10.1021/acs.jnatprod.2c01029]

Source