The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-(4-chlorophenyl)pyridin-3-yl)-2-(3,3-difluorocyclopentane-1-carboxamido)isonicotinamide ID: ALA5286043
Max Phase: Preclinical
Molecular Formula: C23H19ClF2N4O2
Molecular Weight: 456.88
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cnccc1-c1ccc(Cl)cc1)c1ccnc(NC(=O)C2CCC(F)(F)C2)c1
Standard InChI: InChI=1S/C23H19ClF2N4O2/c24-17-3-1-14(2-4-17)18-7-9-27-13-19(18)29-21(31)15-6-10-28-20(11-15)30-22(32)16-5-8-23(25,26)12-16/h1-4,6-7,9-11,13,16H,5,8,12H2,(H,29,31)(H,28,30,32)
Standard InChI Key: HNRLJYOIIWONBJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
1.0646 0.6155 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7791 1.0279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4896 0.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4896 -0.2019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7780 -0.6128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0646 -0.2054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7780 -1.4343 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.7791 1.8494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0646 2.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0646 3.0835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7745 3.4923 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4877 3.0814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4877 2.2640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3531 1.8512 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 2.2620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3581 3.0834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0696 1.8512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7782 2.2613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4896 1.8508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4896 1.0260 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7765 0.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0696 1.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7765 -0.2016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0651 -0.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0651 -1.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7293 -1.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4756 -2.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6545 -2.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4008 -1.9164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4415 -3.4923 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.1389 -2.9099 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-0.3536 -0.2016 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 2 0
5 7 1 0
2 8 1 0
9 8 1 0
10 9 2 0
11 10 1 0
12 11 2 0
13 12 1 0
8 13 2 0
14 9 1 0
15 14 1 0
15 16 2 0
17 15 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 17 2 0
21 23 1 0
23 24 1 0
24 25 1 0
26 25 1 0
27 26 1 0
28 27 1 0
29 28 1 0
29 25 1 0
28 30 1 0
28 31 1 0
24 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.88Molecular Weight (Monoisotopic): 456.1165AlogP: 5.42#Rotatable Bonds: 5Polar Surface Area: 83.98Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.94CX Basic pKa: 4.62CX LogP: 3.87CX LogD: 3.87Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.12
References 1. Luo G, Chen L, Jacutin-Porte S, Han Y, Burton CR, Xiao H, Krause CM, Cao Y, Liu N, Kish K, Lewis HA, Macor JE, Dubowchik GM.. (2023) Structure-activity relationship (SAR) studies on substituted N-(pyridin-3-yl)-2-amino-isonicotinamides as highly potent and selective glycogen synthase kinase-3 (GSK-3) inhibitors., 81 [PMID:36669575 ] [10.1016/j.bmcl.2023.129143 ]