(3R,6S,9R,12S)-3,4,9,10-tetramethyl-6,12-dipentyl-1,7-dioxa-4,10-diazacyclododecane-2,5,8,11-tetraone

ID: ALA5286097

Max Phase: Preclinical

Molecular Formula: C22H38N2O6

Molecular Weight: 426.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC[C@@H]1OC(=O)[C@@H](C)N(C)C(=O)[C@H](CCCCC)OC(=O)[C@@H](C)N(C)C1=O

Standard InChI:  InChI=1S/C22H38N2O6/c1-7-9-11-13-17-19(25)23(5)16(4)22(28)30-18(14-12-10-8-2)20(26)24(6)15(3)21(27)29-17/h15-18H,7-14H2,1-6H3/t15-,16-,17+,18+/m1/s1

Standard InChI Key:  FVEGGDWLWLILJZ-BDXSIMOUSA-N

Molfile:  

 
     RDKit          2D

 30 30  0  0  0  0  0  0  0  0999 V2000
   -0.3968   -1.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4281   -1.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6096   -0.5959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4073   -0.4064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4073    0.4172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5924    0.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4018    1.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4274    1.4013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6133    0.5991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4073    0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4073   -0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5868   -0.5885    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0098    1.9836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0310    0.0168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1035   -0.1841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9842    1.9836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7710    2.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3533    3.3614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1402    4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7225    4.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0104   -1.9837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9897    0.9995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9897   -0.9888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9791   -1.9837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7660   -2.7792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3483   -3.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1352   -4.1569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7175   -4.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9897   -0.9950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9897    0.9927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12  1  1  0
  8 13  2  0
  9 14  1  0
  3 15  1  0
  7 16  1  6
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
  2 21  2  0
  5 22  2  0
  4 23  1  1
  1 24  1  6
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 11 29  2  0
 10 30  1  1
M  END

Alternative Forms

  1. Parent:

    ALA5286097

    ---

Associated Targets(non-human)

Ryr2 Ryanodine receptor 2 (21 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 426.55Molecular Weight (Monoisotopic): 426.2730AlogP: 2.68#Rotatable Bonds: 8
Polar Surface Area: 93.22Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.47CX LogD: 3.47
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.44Np Likeness Score: 0.85

References

1. Smith AN, Blackwell DJ, Knollmann BC, Johnston JN..  (2021)  Ring Size as an Independent Variable in Cyclooligomeric Depsipeptide Antiarrhythmic Activity.,  12  (12.0): [PMID:34917258] [10.1021/acsmedchemlett.1c00508]

Source