The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[3,5-bis(trifluoromethyl)phenyl]methyl (3S)-2-acetyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate ID: ALA5286117
Max Phase: Preclinical
Molecular Formula: C23H18F6N2O3
Molecular Weight: 484.40
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1
Standard InChI: InChI=1S/C23H18F6N2O3/c1-12(32)31-10-19-17(16-4-2-3-5-18(16)30-19)9-20(31)21(33)34-11-13-6-14(22(24,25)26)8-15(7-13)23(27,28)29/h2-8,20,30H,9-11H2,1H3/t20-/m0/s1
Standard InChI Key: YHCARYOWLPOIJH-FQEVSTJZSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-2.1281 -0.8450 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4136 -0.4325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6991 -0.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6991 -1.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4136 -2.0826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1281 -1.6701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2420 -2.8895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0860 -2.2221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4216 -2.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7320 -2.1367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2172 -2.8042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8849 -3.5549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0654 -3.6460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8423 -0.4326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5567 -0.8450 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8423 0.3921 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4136 0.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1279 0.8046 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6761 0.7954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0149 0.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7348 0.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4258 0.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1457 0.7954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8368 0.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8368 -0.4139 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5567 -0.0108 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.5567 0.7954 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1457 1.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4258 2.0335 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4258 2.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4258 3.6460 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7348 3.2429 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.1457 3.2429 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.7348 1.6304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
4 3 1 0
5 4 2 0
1 6 1 0
6 5 1 0
5 7 1 0
4 8 1 0
8 9 2 0
9 7 1 0
8 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
9 13 1 0
1 14 1 0
14 15 1 0
14 16 2 0
2 17 1 6
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
24 27 1 0
23 28 2 0
28 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
30 33 1 0
29 34 2 0
21 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.40Molecular Weight (Monoisotopic): 484.1222AlogP: 5.22#Rotatable Bonds: 3Polar Surface Area: 62.40Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.52CX LogD: 4.52Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -0.63
References 1. Van der Poorten O, Knuhtsen A, Sejer Pedersen D, Ballet S, Tourwé D.. (2016) Side Chain Cyclized Aromatic Amino Acids: Great Tools as Local Constraints in Peptide and Peptidomimetic Design., 59 (24): [PMID:27690430 ] [10.1021/acs.jmedchem.6b01029 ]