[3,5-bis(trifluoromethyl)phenyl]methyl (3S)-2-acetyl-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate

ID: ALA5286117

Max Phase: Preclinical

Molecular Formula: C23H18F6N2O3

Molecular Weight: 484.40

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)N1Cc2[nH]c3ccccc3c2C[C@H]1C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1

Standard InChI:  InChI=1S/C23H18F6N2O3/c1-12(32)31-10-19-17(16-4-2-3-5-18(16)30-19)9-20(31)21(33)34-11-13-6-14(22(24,25)26)8-15(7-13)23(27,28)29/h2-8,20,30H,9-11H2,1H3/t20-/m0/s1

Standard InChI Key:  YHCARYOWLPOIJH-FQEVSTJZSA-N

Molfile:  

 
     RDKit          2D

 34 37  0  0  0  0  0  0  0  0999 V2000
   -2.1281   -0.8450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4136   -0.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6991   -0.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6991   -1.6701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4136   -2.0826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1281   -1.6701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2420   -2.8895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0860   -2.2221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4216   -2.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7320   -2.1367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2172   -2.8042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8849   -3.5549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0654   -3.6460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8423   -0.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5567   -0.8450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8423    0.3921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4136    0.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1279    0.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6761    0.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0149    0.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7348    0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4258    0.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1457    0.7954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8368    0.3922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8368   -0.4139    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5567   -0.0108    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5567    0.7954    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.1457    1.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4258    2.0335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4258    2.8397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4258    3.6460    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7348    3.2429    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.1457    3.2429    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.7348    1.6304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  4  8  1  0
  8  9  2  0
  9  7  1  0
  8 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  9 13  1  0
  1 14  1  0
 14 15  1  0
 14 16  2  0
  2 17  1  6
 17 18  2  0
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 24 27  1  0
 23 28  2  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 32  1  0
 30 33  1  0
 29 34  2  0
 21 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286117

    ---

Associated Targets(Human)

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.40Molecular Weight (Monoisotopic): 484.1222AlogP: 5.22#Rotatable Bonds: 3
Polar Surface Area: 62.40Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 4.52CX LogD: 4.52
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.41Np Likeness Score: -0.63

References

1. Van der Poorten O, Knuhtsen A, Sejer Pedersen D, Ballet S, Tourwé D..  (2016)  Side Chain Cyclized Aromatic Amino Acids: Great Tools as Local Constraints in Peptide and Peptidomimetic Design.,  59  (24): [PMID:27690430] [10.1021/acs.jmedchem.6b01029]

Source