7-methoxy-1,2,9-trimethyl-3,4-dihydropyrido[3,4-b]indol-2-ium

ID: ALA5286201

Max Phase: Preclinical

Molecular Formula: C15H19N2O+

Molecular Weight: 243.33

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2c3c(n(C)c2c1)C(C)=[N+](C)CC3

Standard InChI:  InChI=1S/C15H19N2O/c1-10-15-13(7-8-16(10)2)12-6-5-11(18-4)9-14(12)17(15)3/h5-6,9H,7-8H2,1-4H3/q+1

Standard InChI Key:  BFEGIYKTVGATBR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 18 20  0  0  0  0  0  0  0  0999 V2000
   -1.6220    0.3913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9074    0.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1955    0.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1955   -0.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9056   -0.8452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6220   -0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6086    0.6419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0793   -0.0117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5873   -0.6793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9393    1.3764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7408    1.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2116    0.8036    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8809    0.0691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2836   -0.6284    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3195   -0.8398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0171   -0.4371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7958   -1.4573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0171    0.8036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  7  8  2  0
  9  8  1  0
  4  9  1  0
  7 10  1  0
 10 11  1  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
 13 14  1  0
  6 15  1  0
 15 16  1  0
  9 17  1  0
 12 18  1  0
M  CHG  1  12   1
M  END

Alternative Forms

  1. Parent:

    ALA5286201

    ---

Associated Targets(Human)

MAOA Tclin Monoamine oxidase A (11911 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 243.33Molecular Weight (Monoisotopic): 243.1492AlogP: 2.19#Rotatable Bonds: 1
Polar Surface Area: 17.17Molecular Species: NEUTRALHBA: 2HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: -1.62CX LogD: -1.62
Aromatic Rings: 2Heavy Atoms: 18QED Weighted: 0.70Np Likeness Score: 0.48

References

1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R..  (2021)  β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy.,  64  (3.0): [PMID:33528252] [10.1021/acs.jmedchem.0c01887]

Source