(2S)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-2-(3,3,3-trifluoropropyl)butanediamide

ID: ALA5286214

Max Phase: Preclinical

Molecular Formula: C23H23F3N4O3

Molecular Weight: 460.46

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CN1C(=O)[C@@H](NC(=O)C[C@H](CCC(F)(F)F)C(N)=O)N=C(c2ccccc2)c2ccccc21

Standard InChI:  InChI=1S/C23H23F3N4O3/c1-30-17-10-6-5-9-16(17)19(14-7-3-2-4-8-14)29-21(22(30)33)28-18(31)13-15(20(27)32)11-12-23(24,25)26/h2-10,15,21H,11-13H2,1H3,(H2,27,32)(H,28,31)/t15-,21-/m0/s1

Standard InChI Key:  QNNKZSCTARTOHW-BTYIYWSLSA-N

Molfile:  

 
     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   -3.4772   -0.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7626    0.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0506   -0.0772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0506   -0.9025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7607   -1.3142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4772   -0.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3963   -1.4179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5901   -1.2275    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2364   -0.4811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6038    0.2644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4081    0.4407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6216    1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0203    0.8479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5886   -0.4811    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0013    0.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8267    0.2334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2393    0.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8267    1.6629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2393    2.3777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8267    3.0924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2393    3.8071    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.0013    3.0924    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.4140    3.8071    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.0647    0.9482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4772    1.6629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4772    0.2334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5886    0.9482    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6098   -2.2152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0263   -2.7989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2399   -3.5935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0375   -3.8071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6193   -3.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4104   -2.4297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  4  7  1  0
  7  8  2  0
  9  8  1  0
 10  9  1  0
  3 11  1  0
 11 10  1  0
 11 12  1  0
 10 13  2  0
  9 14  1  1
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  6
 18 19  1  0
 19 20  1  0
 20 21  1  0
 20 22  1  0
 20 23  1  0
 17 24  1  0
 24 25  1  0
 24 26  2  0
 15 27  2  0
  7 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286214

    ---

Associated Targets(non-human)

Cryptosporidium parvum (1150 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.46Molecular Weight (Monoisotopic): 460.1722AlogP: 2.78#Rotatable Bonds: 7
Polar Surface Area: 104.86Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.09CX Basic pKa: 0.37CX LogP: 2.54CX LogD: 2.54
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.66Np Likeness Score: -0.20

References

1. Lee S, Love MS, Modukuri R, Chatterjee AK, Huerta L, Lawson AP, McNamara CW, Mead JR, Hedstrom L, Cuny GD..  (2023)  Structure-activity relationship of BMS906024 derivatives for Cryptosporidium parvum growth inhibition.,  90  [PMID:37196868] [10.1016/j.bmcl.2023.129328]

Source