The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-N'-[(3S)-1-methyl-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-3-yl]-2-(3,3,3-trifluoropropyl)butanediamide ID: ALA5286214
Max Phase: Preclinical
Molecular Formula: C23H23F3N4O3
Molecular Weight: 460.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN1C(=O)[C@@H](NC(=O)C[C@H](CCC(F)(F)F)C(N)=O)N=C(c2ccccc2)c2ccccc21
Standard InChI: InChI=1S/C23H23F3N4O3/c1-30-17-10-6-5-9-16(17)19(14-7-3-2-4-8-14)29-21(22(30)33)28-18(31)13-15(20(27)32)11-12-23(24,25)26/h2-10,15,21H,11-13H2,1H3,(H2,27,32)(H,28,31)/t15-,21-/m0/s1
Standard InChI Key: QNNKZSCTARTOHW-BTYIYWSLSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-3.4772 -0.0776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7626 0.3346 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0506 -0.0772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0506 -0.9025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7607 -1.3142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4772 -0.9062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3963 -1.4179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5901 -1.2275 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2364 -0.4811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6038 0.2644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4081 0.4407 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.6216 1.2380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0203 0.8479 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5886 -0.4811 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0013 0.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8267 0.2334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2393 0.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8267 1.6629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2393 2.3777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8267 3.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2393 3.8071 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.0013 3.0924 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.4140 3.8071 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.0647 0.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4772 1.6629 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4772 0.2334 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5886 0.9482 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6098 -2.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0263 -2.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2399 -3.5935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0375 -3.8071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6193 -3.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4104 -2.4297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
4 7 1 0
7 8 2 0
9 8 1 0
10 9 1 0
3 11 1 0
11 10 1 0
11 12 1 0
10 13 2 0
9 14 1 1
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 6
18 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
20 23 1 0
17 24 1 0
24 25 1 0
24 26 2 0
15 27 2 0
7 28 1 0
29 28 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
28 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.46Molecular Weight (Monoisotopic): 460.1722AlogP: 2.78#Rotatable Bonds: 7Polar Surface Area: 104.86Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.09CX Basic pKa: 0.37CX LogP: 2.54CX LogD: 2.54Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.66Np Likeness Score: -0.20
References 1. Lee S, Love MS, Modukuri R, Chatterjee AK, Huerta L, Lawson AP, McNamara CW, Mead JR, Hedstrom L, Cuny GD.. (2023) Structure-activity relationship of BMS906024 derivatives for Cryptosporidium parvum growth inhibition., 90 [PMID:37196868 ] [10.1016/j.bmcl.2023.129328 ]