(6-((4-(benzo[d]thiazol-5-yl)pyrimidin-2-yl)amino)pyridin-3-yl)(4-ethylpiperazin-1-yl)methanone

ID: ALA5286238

Max Phase: Preclinical

Molecular Formula: C23H23N7OS

Molecular Weight: 445.55

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCN1CCN(C(=O)c2ccc(Nc3nccc(-c4ccc5scnc5c4)n3)nc2)CC1

Standard InChI:  InChI=1S/C23H23N7OS/c1-2-29-9-11-30(12-10-29)22(31)17-4-6-21(25-14-17)28-23-24-8-7-18(27-23)16-3-5-20-19(13-16)26-15-32-20/h3-8,13-15H,2,9-12H2,1H3,(H,24,25,27,28)

Standard InChI Key:  RGRRHQWMAQNGTO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
   -0.3664   -3.0861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3664   -2.2611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3508   -1.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0622   -2.2692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7819   -1.8609    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7819   -1.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4983   -0.6280    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4983    0.1969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    0.6084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2136    1.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5010    1.8476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7854    1.4360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0709    1.8486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0709    2.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565    3.0861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579    2.6736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1422    2.9286    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6273    2.2610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1422    1.5934    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579    1.8484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3565    1.4359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7854    0.6107    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0705   -0.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3508   -1.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0783   -1.8440    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7980   -2.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5036   -1.8318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5036   -1.0048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136   -0.5848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2136    0.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7839   -0.5974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0783   -1.0169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 16  1  0
 20 21  2  0
 21 13  1  0
 12 22  2  0
 22  8  1  0
  6 23  1  0
 23 24  2  0
 24  3  1  0
  2 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 28 31  1  0
 31 32  1  0
 32 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286238

    ---

Associated Targets(Human)

DYRK2 Tchem Dual-specificity tyrosine-phosphorylation regulated kinase 2 (2095 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.55Molecular Weight (Monoisotopic): 445.1685AlogP: 3.67#Rotatable Bonds: 5
Polar Surface Area: 87.14Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.28CX Basic pKa: 7.04CX LogP: 3.22CX LogD: 3.06
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.50Np Likeness Score: -1.98

References

1. Yuan K, Shen H, Zheng M, Xia F, Li Q, Chen W, Ji M, Yang H, Zhuang X, Cai Z, Min W, Wang X, Xiao Y, Yang P..  (2023)  Discovery of Potent DYRK2 Inhibitors with High Selectivity, Great Solubility, and Excellent Safety Properties for the Treatment of Prostate Cancer.,  66  (6): [PMID:36800260] [10.1021/acs.jmedchem.3c00106]

Source