The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-3-chloro-5-(7-(2-((5-chloro-2-(2,4-dimethylpiperazin-1-yl)pyridin-4-yl)amino)-2-oxoethyl)-3-methyl-4-oxo-4,7-dihydro-3H-pyrrolo[2,3-d]pyrimidin-5-yl)-4-fluoro-2-hydroxybenzamide ID: ALA5286263
Max Phase: Preclinical
Molecular Formula: C27H27Cl2FN8O4
Molecular Weight: 617.47
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1CN(C)CCN1c1cc(NC(=O)Cn2cc(-c3cc(C(N)=O)c(O)c(Cl)c3F)c3c(=O)n(C)cnc32)c(Cl)cn1
Standard InChI: InChI=1S/C27H27Cl2FN8O4/c1-13-9-35(2)4-5-38(13)19-7-18(17(28)8-32-19)34-20(39)11-37-10-16(21-26(37)33-12-36(3)27(21)42)14-6-15(25(31)41)24(40)22(29)23(14)30/h6-8,10,12-13,40H,4-5,9,11H2,1-3H3,(H2,31,41)(H,32,34,39)/t13-/m0/s1
Standard InChI Key: UUBZSBJVJMKQMU-ZDUSSCGKSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
-3.6141 0.5197 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8995 0.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1876 0.5200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1876 -0.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8977 -0.7168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6141 -0.3087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4046 -0.5510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9126 0.1166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3834 0.7702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1698 1.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7532 2.1510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5395 2.9455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7422 3.1591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1605 2.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3693 1.7818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6365 2.7932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8501 3.5903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2200 2.2097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5286 3.9562 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1911 -1.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3940 -1.5616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1805 -2.3586 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6165 -2.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2003 -1.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9947 -2.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2084 -2.9998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6288 -3.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8310 -3.3727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2475 -3.9562 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.5782 -1.6190 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3647 -0.8220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9482 -0.2385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7452 -0.4521 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9588 -1.2491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3753 -1.8326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1894 -0.9781 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8995 1.7571 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.3287 0.9322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5676 -0.6084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1230 3.5290 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.5502 1.9375 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.3287 0.1313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
4 7 1 0
7 8 1 0
9 8 2 0
3 9 1 0
10 9 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
14 16 1 0
16 17 2 0
16 18 1 0
13 19 1 0
7 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
28 29 1 0
30 25 1 0
30 31 1 0
32 31 1 0
33 32 1 0
34 33 1 0
35 34 1 0
30 35 1 0
21 36 2 0
2 37 2 0
1 38 1 0
31 39 1 1
12 40 1 0
11 41 1 0
33 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 617.47Molecular Weight (Monoisotopic): 616.1516AlogP: 2.83#Rotatable Bonds: 6Polar Surface Area: 151.61Molecular Species: ACIDHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 5.83CX Basic pKa: 7.69CX LogP: 1.96CX LogD: 1.89Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.30Np Likeness Score: -1.36
References 1. Mamai A, Chau AM, Wilson BJ, Watson ID, Joseph BB, Subramanian PR, Morshed MM, Morin JA, Prakesch MA, Lu T, Connolly P, Kuntz DA, Pomroy NC, Poda G, Nguyen K, Marcellus R, Strathdee G, Theriault B, Subramaniam R, Mohammed M, Abibi A, Chan M, Winston J, Kiyota T, Undzys E, Aman A, Austin N, Du Jardin M, Packman K, Phillippar U, Attar R, Edwards J, O'Meara J, Uehling DE, Al-Awar R, Privé GG, Isaac MB.. (2023) Discovery of OICR12694: A Novel, Potent, Selective, and Orally Bioavailable BCL6 BTB Inhibitor., 14 (2.0): [PMID:36793435 ] [10.1021/acsmedchemlett.2c00502 ]