(2R,4R)-N2-(5-(1-amino-3-cyclopropyl-1-(pyridin-2-yl)propyl)-2-fluorophenyl)-N1-(5-chloropyridin-2-yl)-4-methoxypyrrolidine-1,2-dicarboxamide

ID: ALA5286279

Max Phase: Preclinical

Molecular Formula: C29H32ClFN6O3

Molecular Weight: 567.07

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H]1C[C@H](C(=O)Nc2cc(C(N)(CCC3CC3)c3ccccn3)ccc2F)N(C(=O)Nc2ccc(Cl)cn2)C1

Standard InChI:  InChI=1S/C29H32ClFN6O3/c1-40-21-15-24(37(17-21)28(39)36-26-10-8-20(30)16-34-26)27(38)35-23-14-19(7-9-22(23)31)29(32,12-11-18-5-6-18)25-4-2-3-13-33-25/h2-4,7-10,13-14,16,18,21,24H,5-6,11-12,15,17,32H2,1H3,(H,35,38)(H,34,36,39)/t21-,24-,29?/m1/s1

Standard InChI Key:  HMKGSFLIMYOEKX-ZORXERLGSA-N

Molfile:  

 
     RDKit          2D

 40 44  0  0  0  0  0  0  0  0999 V2000
    0.7791    0.1772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4937    0.5895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2056    0.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2056   -0.6475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4955   -1.0593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7791   -0.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4955   -1.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2102   -2.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9250   -1.8846    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6370   -2.2966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6370   -3.1221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9268   -3.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2102   -3.1258    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7809   -2.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0663   -1.8845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6483   -2.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4750   -2.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0617   -3.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2819   -2.6816    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4937    1.4147    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0645    0.5898    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0645    1.4150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6500    1.8276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4035    1.4921    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9554    2.1051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5430    2.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7362    2.6478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9557    3.5340    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6170    0.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0336    0.1115    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4141    0.4815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6277   -0.3155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0444   -0.8992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2580   -1.6937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0553   -1.9073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6370   -1.3278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4282   -0.5300    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2689   -2.7044    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.7791    1.8276    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7808    3.5340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  9  8  2  0
 10  9  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 17 16  1  0
 17 18  1  0
 16 18  1  0
  7 19  1  0
  2 20  1  0
  1 21  1  0
 21 22  1  0
 23 22  1  6
 24 23  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 23  1  0
 26 28  1  6
 24 29  1  0
 29 30  2  0
 29 31  1  0
 31 32  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 36 35  1  0
 37 36  2  0
 32 37  1  0
 35 38  1  0
 22 39  2  0
 28 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286279

    ---

Associated Targets(Human)

KLKB1 Tclin Plasma kallikrein (2047 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 567.07Molecular Weight (Monoisotopic): 566.2208AlogP: 4.92#Rotatable Bonds: 9
Polar Surface Area: 122.47Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.24CX Basic pKa: 7.78CX LogP: 3.93CX LogD: 3.40
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.34Np Likeness Score: -1.40

References

1. Xie Z, Li Z, Shao Y, Liao C..  (2020)  Discovery and development of plasma kallikrein inhibitors for multiple diseases.,  190  [PMID:32066009] [10.1016/j.ejmech.2020.112137]

Source