7-(3-(5-chloro-2-(2,4-dichlorophenoxy)phenoxy)propoxy)-4-methyl-2H-chromen-2-one

ID: ALA5286322

Max Phase: Preclinical

Molecular Formula: C25H19Cl3O5

Molecular Weight: 505.78

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1cc(=O)oc2cc(OCCCOc3cc(Cl)ccc3Oc3ccc(Cl)cc3Cl)ccc12

Standard InChI:  InChI=1S/C25H19Cl3O5/c1-15-11-25(29)33-23-14-18(5-6-19(15)23)30-9-2-10-31-24-13-17(27)4-8-22(24)32-21-7-3-16(26)12-20(21)28/h3-8,11-14H,2,9-10H2,1H3

Standard InChI Key:  IFABHYSFGQEAKO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -4.9977   -1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2831   -0.8217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5713   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5713   -2.0588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2813   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9977   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2831    0.0033    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -5.7124   -2.4751    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -0.8210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -1.2337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4272   -0.8212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7151   -1.2332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7151   -2.0587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4254   -2.4706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1420   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4272    0.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0004   -2.4713    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.7125    0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0020    0.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7166    0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4313    0.0039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1459    0.4165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1462    1.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8590    1.6524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5739    1.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5754    0.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8636    0.0021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2822    1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9944    1.2408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9978    0.4238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2904    0.0079    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7124    0.0112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2822    2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  2  7  1  0
  6  8  1  0
  3  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
 14 13  1  0
 15 14  2  0
 10 15  1  0
 11 16  1  0
 13 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 25 28  1  0
 29 28  2  0
 30 29  1  0
 31 30  1  0
 26 31  1  0
 30 32  2  0
 28 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286322

    ---

Associated Targets(non-human)

Leishmania panamensis (230 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 505.78Molecular Weight (Monoisotopic): 504.0298AlogP: 7.70#Rotatable Bonds: 8
Polar Surface Area: 57.90Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 6.94CX LogD: 6.94
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.18Np Likeness Score: -0.64

References

1. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V..  (2020)  Natural and synthetic coumarins as antileishmanial agents: A review.,  203  [PMID:32668302] [10.1016/j.ejmech.2020.112514]

Source