The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
7-(3-(5-chloro-2-(2,4-dichlorophenoxy)phenoxy)propoxy)-4-methyl-2H-chromen-2-one ID: ALA5286322
Max Phase: Preclinical
Molecular Formula: C25H19Cl3O5
Molecular Weight: 505.78
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(=O)oc2cc(OCCCOc3cc(Cl)ccc3Oc3ccc(Cl)cc3Cl)ccc12
Standard InChI: InChI=1S/C25H19Cl3O5/c1-15-11-25(29)33-23-14-18(5-6-19(15)23)30-9-2-10-31-24-13-17(27)4-8-22(24)32-21-7-3-16(26)12-20(21)28/h3-8,11-14H,2,9-10H2,1H3
Standard InChI Key: IFABHYSFGQEAKO-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-4.9977 -1.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2831 -0.8217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5713 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5713 -2.0588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2813 -2.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9977 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2831 0.0033 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-5.7124 -2.4751 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.8566 -0.8210 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -1.2337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4272 -0.8212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7151 -1.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7151 -2.0587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4254 -2.4706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1420 -2.0624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4272 0.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.0004 -2.4713 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.7125 0.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0020 0.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7166 0.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4313 0.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1459 0.4165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1462 1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8590 1.6524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5739 1.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5754 0.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8636 0.0021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2822 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9944 1.2408 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9978 0.4238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2904 0.0079 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7124 0.0112 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2822 2.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
2 7 1 0
6 8 1 0
3 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
11 16 1 0
13 17 1 0
16 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
25 28 1 0
29 28 2 0
30 29 1 0
31 30 1 0
26 31 1 0
30 32 2 0
28 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 505.78Molecular Weight (Monoisotopic): 504.0298AlogP: 7.70#Rotatable Bonds: 8Polar Surface Area: 57.90Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.94CX LogD: 6.94Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.18Np Likeness Score: -0.64
References 1. Gonçalves GA, Spillere AR, das Neves GM, Kagami LP, von Poser GL, Canto RFS, Eifler-Lima V.. (2020) Natural and synthetic coumarins as antileishmanial agents: A review., 203 [PMID:32668302 ] [10.1016/j.ejmech.2020.112514 ]