10,13-dimethyl-17-(2-methylthiazol-5-yl)-2,3,4,7,8,9,10,11,12,13,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol

ID: ALA5286337

Max Phase: Preclinical

Molecular Formula: C23H31NOS

Molecular Weight: 369.57

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ncc(C2=CCC3C4CC=C5CC(O)CCC5(C)C4CCC23C)s1

Standard InChI:  InChI=1S/C23H31NOS/c1-14-24-13-21(26-14)20-7-6-18-17-5-4-15-12-16(25)8-10-22(15,2)19(17)9-11-23(18,20)3/h4,7,13,16-19,25H,5-6,8-12H2,1-3H3

Standard InChI Key:  QLYYGIKTZQTDCY-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 26 30  0  0  0  0  0  0  0  0999 V2000
   -2.5311   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5311   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8166   -2.6526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1022   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1022   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8166   -1.0026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3877   -1.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3267   -1.4152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3267   -2.2402    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3877   -2.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0412   -1.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0412   -0.1777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3267    0.2347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3877   -0.1776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8453    0.0723    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3159   -0.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8240   -1.2486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0588    0.8694    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7864    1.2492    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.6623    2.0692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8671    2.1986    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4753    1.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2458    2.6528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1327    0.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1022   -0.5899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2458   -2.6528    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  5  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  2  0
  8 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
  7 14  1  0
 12 15  1  0
 15 16  2  0
 17 16  1  0
 11 17  1  0
 18 15  1  0
 18 19  1  0
 19 20  1  0
 21 20  2  0
 22 21  1  0
 18 22  2  0
 20 23  1  0
 12 24  1  0
  5 25  1  0
  2 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5286337

    ---

Associated Targets(Human)

CYP3A4 Tclin Cytochrome P450 (380 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 369.57Molecular Weight (Monoisotopic): 369.2126AlogP: 5.77#Rotatable Bonds: 1
Polar Surface Area: 33.12Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 3.50CX LogP: 4.10CX LogD: 4.10
Aromatic Rings: 1Heavy Atoms: 26QED Weighted: 0.64Np Likeness Score: 1.73

References

1. Sharma PC, Bansal KK, Sharma A, Sharma D, Deep A..  (2020)  Thiazole-containing compounds as therapeutic targets for cancer therapy.,  188  [PMID:31926469] [10.1016/j.ejmech.2019.112016]

Source